Brickellin
Internal ID | a05e1371-6101-4301-9012-2448679da1e9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 5-hydroxy-2-(2-hydroxy-4,5-dimethoxyphenyl)-3,6,7-trimethoxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)OC)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)OC)O)OC |
InChI | InChI=1S/C20H20O9/c1-24-11-6-9(10(21)7-12(11)25-2)18-20(28-5)17(23)15-13(29-18)8-14(26-3)19(27-4)16(15)22/h6-8,21-22H,1-5H3 |
InChI Key | USWPTYUGAMOLAB-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C20H20O9 |
Molecular Weight | 404.40 g/mol |
Exact Mass | 404.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 3.10 |
MQ8CVA2BQ4 |
UNII-MQ8CVA2BQ4 |
90357-63-4 |
4H-1-Benzopyran-4-one, 5-hydroxy-2-(2-hydroxy-4,5-dimethoxyphenyl)-3,6,7-trimethoxy- |
5-Hydroxy-2-(2-hydroxy-4,5-dimethoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
CHEMBL484666 |
DTXSID50551638 |
LMPK12113062 |
5,2'-dihydroxy-3,6,7,4',5'-penta-methoxyflavone |
Q4965995 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.56% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.45% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.72% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.14% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.84% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 89.47% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 89.07% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.12% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 86.41% | 98.75% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.59% | 94.42% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.87% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.70% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.27% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.44% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acanthostyles buniifolius |
Brickellia glutinosa |
Brickellia veronicaefolia |
Chrysosplenium grayanum |
Varronia curassavica |
PubChem | 13871363 |
LOTUS | LTS0249758 |
wikiData | Q4965995 |