Bradykinin
| Internal ID | 9f1f5449-2e27-47c9-a903-bd1d5d39be5b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[2-[[(2S)-1-[(2S)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES (Canonical) | C1CC(N(C1)C(=O)C2CCCN2C(=O)C(CCCN=C(N)N)N)C(=O)NCC(=O)NC(CC3=CC=CC=C3)C(=O)NC(CO)C(=O)N4CCCC4C(=O)NC(CC5=CC=CC=C5)C(=O)NC(CCCN=C(N)N)C(=O)O |
| SMILES (Isomeric) | C1C[C@H](N(C1)C(=O)[C@@H]2CCCN2C(=O)[C@H](CCCN=C(N)N)N)C(=O)NCC(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N[C@@H](CO)C(=O)N4CCC[C@H]4C(=O)N[C@@H](CC5=CC=CC=C5)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C50H73N15O11/c51-32(16-7-21-56-49(52)53)45(72)65-25-11-20-39(65)47(74)64-24-9-18-37(64)43(70)58-28-40(67)59-34(26-30-12-3-1-4-13-30)41(68)62-36(29-66)46(73)63-23-10-19-38(63)44(71)61-35(27-31-14-5-2-6-15-31)42(69)60-33(48(75)76)17-8-22-57-50(54)55/h1-6,12-15,32-39,66H,7-11,16-29,51H2,(H,58,70)(H,59,67)(H,60,69)(H,61,71)(H,62,68)(H,75,76)(H4,52,53,56)(H4,54,55,57)/t32-,33-,34-,35-,36-,37-,38-,39-/m0/s1 |
| InChI Key | QXZGBUJJYSLZLT-FDISYFBBSA-N |
| Popularity | 14,465 references in papers |
| Molecular Formula | C50H73N15O11 |
| Molecular Weight | 1060.20 g/mol |
| Exact Mass | 1059.56139820 g/mol |
| Topological Polar Surface Area (TPSA) | 419.00 Ų |
| XlogP | -4.80 |
| Atomic LogP (AlogP) | -3.99 |
| H-Bond Acceptor | 13 |
| H-Bond Donor | 12 |
| Rotatable Bonds | 27 |
| 58-82-2 |
| L-Bradykinin |
| Kallidin I |
| Callidin I |
| Kallidin-9 |
| (2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[2-[[(2S)-1-[(2S)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| BRS-640 |
| Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg |
| S8TIM42R2W |
| CHEBI:3165 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7218 | 72.18% |
| Caco-2 | - | 0.8655 | 86.55% |
| Blood Brain Barrier | - | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.6845 | 68.45% |
| OATP2B1 inhibitior | - | 0.8584 | 85.84% |
| OATP1B1 inhibitior | + | 0.8531 | 85.31% |
| OATP1B3 inhibitior | + | 0.9399 | 93.99% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | - | 0.6750 | 67.50% |
| BSEP inhibitior | + | 0.9787 | 97.87% |
| P-glycoprotein inhibitior | + | 0.7435 | 74.35% |
| P-glycoprotein substrate | + | 0.7524 | 75.24% |
| CYP3A4 substrate | + | 0.7033 | 70.33% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7971 | 79.71% |
| CYP3A4 inhibition | - | 0.7305 | 73.05% |
| CYP2C9 inhibition | - | 0.9267 | 92.67% |
| CYP2C19 inhibition | - | 0.8225 | 82.25% |
| CYP2D6 inhibition | - | 0.9224 | 92.24% |
| CYP1A2 inhibition | - | 0.8858 | 88.58% |
| CYP2C8 inhibition | + | 0.5219 | 52.19% |
| CYP inhibitory promiscuity | - | 0.9872 | 98.72% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5957 | 59.57% |
| Eye corrosion | - | 0.9892 | 98.92% |
| Eye irritation | - | 0.8985 | 89.85% |
| Skin irritation | - | 0.7594 | 75.94% |
| Skin corrosion | - | 0.9326 | 93.26% |
| Ames mutagenesis | - | 0.6700 | 67.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6466 | 64.66% |
| Micronuclear | + | 0.8500 | 85.00% |
| Hepatotoxicity | - | 0.5976 | 59.76% |
| skin sensitisation | - | 0.8694 | 86.94% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.8250 | 82.50% |
| Nephrotoxicity | - | 0.8532 | 85.32% |
| Acute Oral Toxicity (c) | III | 0.6133 | 61.33% |
| Estrogen receptor binding | + | 0.7626 | 76.26% |
| Androgen receptor binding | + | 0.6702 | 67.02% |
| Thyroid receptor binding | + | 0.6119 | 61.19% |
| Glucocorticoid receptor binding | + | 0.5782 | 57.82% |
| Aromatase binding | + | 0.6747 | 67.47% |
| PPAR gamma | + | 0.6540 | 65.40% |
| Honey bee toxicity | - | 0.8211 | 82.11% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.6000 | 60.00% |
| Fish aquatic toxicity | + | 0.7244 | 72.44% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.72% | 98.95% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.44% | 98.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.39% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.68% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.27% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.03% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.85% | 90.20% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.78% | 90.17% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 96.49% | 82.69% |
| CHEMBL204 | P00734 | Thrombin | 96.35% | 96.01% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 96.02% | 96.03% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.60% | 97.64% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.35% | 91.81% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 95.19% | 96.67% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.69% | 89.63% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.38% | 99.17% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 93.83% | 97.79% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.50% | 98.24% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 92.93% | 96.67% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.34% | 97.09% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 91.66% | 96.67% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.61% | 93.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.57% | 100.00% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 91.56% | 98.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.26% | 90.71% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.02% | 93.10% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.67% | 94.45% |
| CHEMBL236 | P41143 | Delta opioid receptor | 90.57% | 99.35% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.56% | 88.42% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 90.46% | 89.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.58% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.32% | 95.89% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 88.93% | 99.52% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 88.37% | 98.10% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.33% | 97.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.96% | 95.56% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 87.85% | 93.33% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.69% | 97.93% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.47% | 97.21% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.94% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.88% | 93.56% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 85.34% | 82.86% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 85.32% | 95.52% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.40% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.38% | 98.75% |
| CHEMBL5028 | O14672 | ADAM10 | 83.72% | 97.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.65% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.59% | 91.19% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 82.51% | 97.00% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 82.47% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.50% | 95.00% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 80.84% | 98.77% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.77% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 439201 |
| LOTUS | LTS0150409 |
| wikiData | Q24745328 |