Bovistol B
| Internal ID | 12851aab-65a0-4daf-8361-e306092eb3dd |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
| IUPAC Name | |
| SMILES (Canonical) | CC1=C2CC(CC2=C3C(=C1CCO)CCC4(O3)C(=O)C5=C(CC(C5)(C)CO)C(=C)C46CC6)(C)CO |
| SMILES (Isomeric) | CC1=C2C[C@@](CC2=C3C(=C1CCO)CC[C@]4(O3)C(=O)C5=C(C[C@@](C5)(C)CO)C(=C)C46CC6)(C)CO |
| InChI | InChI=1S/C30H38O5/c1-17-19(6-10-31)20-5-7-30(35-25(20)23-13-27(3,15-32)11-21(17)23)26(34)24-14-28(4,16-33)12-22(24)18(2)29(30)8-9-29/h31-33H,2,5-16H2,1,3-4H3/t27-,28-,30+/m1/s1 |
| InChI Key | DIWWDOPEJUPABS-QVKOCQLISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27192431 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.88% | 91.11% |
| CHEMBL240 | Q12809 | HERG | 90.12% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.99% | 95.56% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 86.43% | 97.50% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.01% | 96.43% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.98% | 97.25% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.06% | 89.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.84% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.42% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.92% | 86.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.88% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683530 |
| LOTUS | LTS0200829 |
| wikiData | Q104981755 |