Boussingoside E
Internal ID | e5610873-55a6-4336-ad45-5bca30485517 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4R,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-4-(hydroxymethyl)-4,6a,6b,14b-tetramethyl-11-methylidene-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC12CCC(C(C1CCC3(C2CC=C4C3(CCC5(C4CC(=C)CC5)C(=O)OC6C(C(C(C(O6)CO)O)O)O)C)C)(C)CO)OC7C(C(C(C(O7)C(=O)O)O)O)O |
SMILES (Isomeric) | C[C@]12CC[C@@H]([C@@]([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(=C)CC5)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C)(C)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)O)O)O)O |
InChI | InChI=1S/C41H62O15/c1-19-8-13-41(36(52)56-34-30(48)27(45)26(44)22(17-42)53-34)15-14-39(4)20(21(41)16-19)6-7-24-37(2)11-10-25(38(3,18-43)23(37)9-12-40(24,39)5)54-35-31(49)28(46)29(47)32(55-35)33(50)51/h6,21-32,34-35,42-49H,1,7-18H2,2-5H3,(H,50,51)/t21-,22+,23+,24+,25-,26+,27-,28-,29-,30+,31+,32-,34-,35+,37-,38-,39+,40+,41-/m0/s1 |
InChI Key | XZLYKCFSWUWOSX-GUZNCPQZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C41H62O15 |
Molecular Weight | 794.90 g/mol |
Exact Mass | 794.40887127 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 1.80 |
CHEMBL2043374 |
DTXSID301106503 |
(3beta,4alpha)-28-(beta-D-Glucopyranosyloxy)-23-hydroxy-28-oxo-30-noroleana-12,20(29)-dien-3-yl beta-D-glucopyranosiduronic acid |
184095-70-3 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.36% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.94% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.60% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.74% | 94.45% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.43% | 98.10% |
CHEMBL2581 | P07339 | Cathepsin D | 90.36% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.31% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.92% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.05% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.74% | 86.33% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.76% | 97.93% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.66% | 93.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.18% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.60% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 84.16% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.98% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.78% | 92.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.16% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.75% | 94.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.07% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anredera baselloides |
Salicornia europaea |
Salicornia maritima |
PubChem | 10819104 |
NPASS | NPC11551 |
ChEMBL | CHEMBL2043374 |
LOTUS | LTS0086121 |
wikiData | Q105345031 |