Bleomycin B1'
| Internal ID | b8f7958b-a4eb-4914-bda7-0f97528d91d3 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | [(2S,3R,4R,5R,6R)-2-[(2R,3R,4R,5S,6S)-2-[(1S,2S)-2-[[6-amino-2-[(1S)-3-amino-1-[[(2R)-2,3-diamino-3-oxopropyl]amino]-3-oxopropyl]-5-methylpyrimidine-4-carbonyl]amino]-3-[[(2S,3S,4R)-5-[[(2R,3S)-1-[2-[4-(4-carbamoyl-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]ethylamino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-4-methyl-5-oxopentan-2-yl]amino]-1-(1H-imidazol-5-yl)-3-oxopropoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] carbamate |
| SMILES (Canonical) | CC1=C(N=C(N=C1N)C(CC(=O)N)NCC(C(=O)N)N)C(=O)NC(C(C2=CN=CN2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)NC(C)C(C(C)C(=O)NC(C(C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)N)O |
| SMILES (Isomeric) | CC1=C(N=C(N=C1N)[C@H](CC(=O)N)NC[C@H](C(=O)N)N)C(=O)N[C@@H]([C@@H](C2=CN=CN2)O[C@H]3[C@@H]([C@@H]([C@@H]([C@@H](O3)CO)O)O)O[C@H]4[C@@H]([C@@H]([C@@H]([C@H](O4)CO)O)OC(=O)N)O)C(=O)N[C@@H](C)[C@H]([C@@H](C)C(=O)N[C@H]([C@H](C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)N)O |
| InChI | InChI=1S/C50H73N17O21S2/c1-15-28(64-42(67-39(15)53)20(7-26(52)71)59-8-19(51)40(54)77)45(81)66-30(36(21-9-57-14-60-21)86-49-38(34(75)32(73)24(10-68)85-49)87-48-35(76)37(88-50(56)83)33(74)25(11-69)84-48)46(82)61-17(3)31(72)16(2)43(79)65-29(18(4)70)44(80)58-6-5-27-62-23(13-89-27)47-63-22(12-90-47)41(55)78/h9,12-14,16-20,24-25,29-38,48-49,59,68-70,72-76H,5-8,10-11,51H2,1-4H3,(H2,52,71)(H2,54,77)(H2,55,78)(H2,56,83)(H,57,60)(H,58,80)(H,61,82)(H,65,79)(H,66,81)(H2,53,64,67)/t16-,17+,18+,19-,20+,24+,25-,29-,30+,31+,32-,33-,34-,35-,36-,37-,38-,48+,49+/m1/s1 |
| InChI Key | NYJRSYHHHBHHOR-NBANDJESSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C50H73N17O21S2 |
| Molecular Weight | 1312.40 g/mol |
| Exact Mass | 1311.46083475 g/mol |
| Topological Polar Surface Area (TPSA) | 698.00 Ų |
| XlogP | -8.90 |
| Atomic LogP (AlogP) | -8.60 |
| H-Bond Acceptor | 31 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 31 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5699 | 56.99% |
| Caco-2 | - | 0.8601 | 86.01% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.8429 | 84.29% |
| Subcellular localzation | Mitochondria | 0.4289 | 42.89% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8049 | 80.49% |
| OATP1B3 inhibitior | + | 0.9370 | 93.70% |
| MATE1 inhibitior | - | 0.9219 | 92.19% |
| OCT2 inhibitior | - | 0.9061 | 90.61% |
| BSEP inhibitior | + | 0.9227 | 92.27% |
| P-glycoprotein inhibitior | + | 0.7420 | 74.20% |
| P-glycoprotein substrate | + | 0.8538 | 85.38% |
| CYP3A4 substrate | + | 0.7495 | 74.95% |
| CYP2C9 substrate | - | 0.5927 | 59.27% |
| CYP2D6 substrate | - | 0.8483 | 84.83% |
| CYP3A4 inhibition | + | 0.6770 | 67.70% |
| CYP2C9 inhibition | - | 0.7035 | 70.35% |
| CYP2C19 inhibition | - | 0.6804 | 68.04% |
| CYP2D6 inhibition | - | 0.8781 | 87.81% |
| CYP1A2 inhibition | - | 0.7817 | 78.17% |
| CYP2C8 inhibition | + | 0.8482 | 84.82% |
| CYP inhibitory promiscuity | - | 0.7240 | 72.40% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.5624 | 56.24% |
| Eye corrosion | - | 0.9842 | 98.42% |
| Eye irritation | - | 0.8958 | 89.58% |
| Skin irritation | - | 0.7745 | 77.45% |
| Skin corrosion | - | 0.9271 | 92.71% |
| Ames mutagenesis | + | 0.8963 | 89.63% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7097 | 70.97% |
| Micronuclear | + | 0.8000 | 80.00% |
| Hepatotoxicity | - | 0.7500 | 75.00% |
| skin sensitisation | - | 0.8530 | 85.30% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | + | 0.6950 | 69.50% |
| Acute Oral Toxicity (c) | III | 0.5917 | 59.17% |
| Estrogen receptor binding | - | 0.5237 | 52.37% |
| Androgen receptor binding | + | 0.8492 | 84.92% |
| Thyroid receptor binding | + | 0.8133 | 81.33% |
| Glucocorticoid receptor binding | + | 0.8253 | 82.53% |
| Aromatase binding | + | 0.8324 | 83.24% |
| PPAR gamma | + | 0.7914 | 79.14% |
| Honey bee toxicity | - | 0.6165 | 61.65% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.6300 | 63.00% |
| Fish aquatic toxicity | + | 0.7014 | 70.14% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.43% | 96.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 98.92% | 96.21% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 97.65% | 98.05% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.40% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.25% | 91.11% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 97.08% | 92.29% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.74% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.94% | 94.45% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 95.78% | 97.53% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.77% | 99.23% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.79% | 89.34% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.74% | 97.36% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.64% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.78% | 96.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.62% | 85.14% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 92.37% | 96.28% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.34% | 93.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.47% | 96.90% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.23% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.87% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.59% | 93.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.49% | 95.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.45% | 95.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.78% | 99.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.50% | 94.75% |
| CHEMBL1881 | P43116 | Prostanoid EP2 receptor | 87.50% | 93.00% |
| CHEMBL5028 | O14672 | ADAM10 | 87.09% | 97.50% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 86.74% | 94.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 86.44% | 82.86% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.24% | 97.09% |
| CHEMBL3776 | Q14790 | Caspase-8 | 85.97% | 97.06% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.96% | 90.17% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 85.92% | 95.48% |
| CHEMBL3663 | P62993 | Growth factor receptor-bound protein 2 | 85.61% | 90.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.76% | 95.71% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 84.70% | 88.33% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 84.29% | 88.42% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.05% | 97.79% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 83.43% | 93.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.82% | 94.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.60% | 89.67% |
| CHEMBL4071 | P08311 | Cathepsin G | 81.38% | 94.64% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.97% | 97.47% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.60% | 94.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.18% | 90.08% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.05% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589344 |
| LOTUS | LTS0084459 |
| wikiData | Q105187537 |