Bisphenol A
Internal ID | 45e8b8de-891d-4827-8d94-246869c2c7d0 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylmethanes > Bisphenols |
IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
SMILES (Canonical) | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
SMILES (Isomeric) | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
InChI | InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3 |
InChI Key | IISBACLAFKSPIT-UHFFFAOYSA-N |
Popularity | 20,701 references in papers |
Molecular Formula | C15H16O2 |
Molecular Weight | 228.29 g/mol |
Exact Mass | 228.115029749 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 3.30 |
Atomic LogP (AlogP) | 3.42 |
H-Bond Acceptor | 2 |
H-Bond Donor | 2 |
Rotatable Bonds | 2 |
80-05-7 |
2,2-Bis(4-hydroxyphenyl)propane |
4,4'-Isopropylidenediphenol |
Diphenylolpropane |
4,4'-Bisphenol A |
Bisphenol |
Diano |
Bisphenol-A |
4,4'-(propane-2,2-diyl)diphenol |
Biphenol A |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9959 | 99.59% |
Caco-2 | + | 0.7639 | 76.39% |
Blood Brain Barrier | + | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.6000 | 60.00% |
Subcellular localzation | Mitochondria | 0.8727 | 87.27% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8753 | 87.53% |
OATP1B3 inhibitior | + | 0.9331 | 93.31% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | - | 0.5342 | 53.42% |
P-glycoprotein inhibitior | - | 0.9383 | 93.83% |
P-glycoprotein substrate | - | 0.9316 | 93.16% |
CYP3A4 substrate | - | 0.6995 | 69.95% |
CYP2C9 substrate | - | 0.7461 | 74.61% |
CYP2D6 substrate | - | 0.6869 | 68.69% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | + | 0.7061 | 70.61% |
CYP2C19 inhibition | - | 0.5944 | 59.44% |
CYP2D6 inhibition | - | 0.9305 | 93.05% |
CYP1A2 inhibition | + | 0.5276 | 52.76% |
CYP2C8 inhibition | - | 0.8138 | 81.38% |
CYP inhibitory promiscuity | - | 0.5417 | 54.17% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.6055 | 60.55% |
Carcinogenicity (trinary) | Non-required | 0.6960 | 69.60% |
Eye corrosion | - | 0.9197 | 91.97% |
Eye irritation | + | 1.0000 | 100.00% |
Skin irritation | - | 0.8721 | 87.21% |
Skin corrosion | - | 0.9639 | 96.39% |
Ames mutagenesis | - | 1.0000 | 100.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7654 | 76.54% |
Micronuclear | - | 0.7100 | 71.00% |
Hepatotoxicity | - | 0.5205 | 52.05% |
skin sensitisation | + | 0.7810 | 78.10% |
Respiratory toxicity | - | 0.8000 | 80.00% |
Reproductive toxicity | + | 0.7111 | 71.11% |
Mitochondrial toxicity | - | 0.8750 | 87.50% |
Nephrotoxicity | + | 0.6424 | 64.24% |
Acute Oral Toxicity (c) | III | 0.8640 | 86.40% |
Estrogen receptor binding | + | 0.9699 | 96.99% |
Androgen receptor binding | + | 0.8748 | 87.48% |
Thyroid receptor binding | + | 0.6636 | 66.36% |
Glucocorticoid receptor binding | + | 0.9047 | 90.47% |
Aromatase binding | + | 0.8704 | 87.04% |
PPAR gamma | + | 0.8708 | 87.08% |
Honey bee toxicity | - | 0.9840 | 98.40% |
Biodegradation | - | 0.9750 | 97.50% |
Crustacea aquatic toxicity | + | 0.6900 | 69.00% |
Fish aquatic toxicity | + | 0.9384 | 93.84% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL1871 | P10275 | Androgen Receptor |
5900 nM |
IC50 |
PMID: 23768907
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
25118.9 nM 6309.6 nM 25118.9 nM 6309.6 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
CHEMBL238 | Q01959 | Dopamine transporter |
19015 nM |
IC50 |
via CMAUP
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL206 | P03372 | Estrogen receptor alpha |
2271 nM 290 nM |
IC50 EC50 |
via CMAUP
via Super-PRED |
CHEMBL242 | Q92731 | Estrogen receptor beta |
1100 nM 757 nM |
EC50 EC50 |
PMID: 23768907
via Super-PRED |
CHEMBL222 | P23975 | Norepinephrine transporter |
16620 nM |
IC50 |
via CMAUP
|
CHEMBL3371 | P50406 | Serotonin 6 (5-HT6) receptor |
5420 nM |
IC50 |
via CMAUP
|
CHEMBL228 | P31645 | Serotonin transporter |
20325 nM |
IC50 |
via CMAUP
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
39810.7 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 87.48% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.40% | 91.11% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.85% | 90.93% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 85.11% | 92.51% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.86% | 93.65% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.51% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.18% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.59% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Panax ginseng |
PubChem | 6623 |
NPASS | NPC92730 |
ChEMBL | CHEMBL418971 |