Bisisomahanine
Internal ID | 63974c64-3b05-4f2e-a86b-b3aec983f3b8 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 10-[9-hydroxy-3,8-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazol-10-yl]-3,8-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazol-9-ol |
SMILES (Canonical) | CC1=CC2=C(C(=C1O)C3=C(C(=CC4=C3NC5=C4C=CC6=C5C=CC(O6)(C)CCC=C(C)C)C)O)NC7=C2C=CC8=C7C=CC(O8)(C)CCC=C(C)C |
SMILES (Isomeric) | CC1=CC2=C(C(=C1O)C3=C(C(=CC4=C3NC5=C4C=CC6=C5C=CC(O6)(C)CCC=C(C)C)C)O)NC7=C2C=CC8=C7C=CC(O8)(C)CCC=C(C)C |
InChI | InChI=1S/C46H48N2O4/c1-25(2)11-9-19-45(7)21-17-31-35(51-45)15-13-29-33-23-27(5)43(49)37(41(33)47-39(29)31)38-42-34(24-28(6)44(38)50)30-14-16-36-32(40(30)48-42)18-22-46(8,52-36)20-10-12-26(3)4/h11-18,21-24,47-50H,9-10,19-20H2,1-8H3 |
InChI Key | VTFGIJSSZQHPNT-UHFFFAOYSA-N |
Popularity | 33 references in papers |
Molecular Formula | C46H48N2O4 |
Molecular Weight | 692.90 g/mol |
Exact Mass | 692.36140802 g/mol |
Topological Polar Surface Area (TPSA) | 90.50 Ų |
XlogP | 12.20 |
Bispyrafoline D |
AKOS040734279 |
10-[9-hydroxy-3,8-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazol-10-yl]-3,8-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazol-9-ol |
832726-58-6 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.79% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.31% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.72% | 94.73% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.56% | 94.80% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.15% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.19% | 89.00% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 91.98% | 93.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.34% | 86.33% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.87% | 85.30% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.99% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.43% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.42% | 96.09% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.21% | 97.28% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.18% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.55% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.94% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.08% | 100.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.83% | 91.71% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.32% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Atalantia stenocarpa |
PubChem | 11273983 |
LOTUS | LTS0193555 |
wikiData | Q105292704 |