Bis-malleicyprol
| Internal ID | dd6ecf67-2787-4c13-a8cd-01132f82fdb0 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | 5-(1-hydroxycyclopropyl)-5-[2-(1-hydroxycyclopropyl)-4-[(E)-2-methyldec-2-enoyl]-5-oxooxolan-3-yl]-3-[(E)-2-methyldec-2-enoyl]furan-2-one |
| SMILES (Canonical) | CCCCCCCC=C(C)C(=O)C1C(C(OC1=O)C2(CC2)O)C3(C=C(C(=O)O3)C(=O)C(=CCCCCCCC)C)C4(CC4)O |
| SMILES (Isomeric) | CCCCCCC/C=C(\C)/C(=O)C1C(C(OC1=O)C2(CC2)O)C3(C=C(C(=O)O3)C(=O)/C(=C/CCCCCCC)/C)C4(CC4)O |
| InChI | InChI=1S/C36H52O8/c1-5-7-9-11-13-15-17-24(3)29(37)26-23-36(44-32(26)39,35(42)21-22-35)28-27(33(40)43-31(28)34(41)19-20-34)30(38)25(4)18-16-14-12-10-8-6-2/h17-18,23,27-28,31,41-42H,5-16,19-22H2,1-4H3/b24-17+,25-18+ |
| InChI Key | SJLJWMBBWANEHT-WZGDJCGDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H52O8 |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.36621861 g/mol |
| Topological Polar Surface Area (TPSA) | 127.00 Ų |
| XlogP | 7.90 |
| 5-(1-hydroxycyclopropyl)-5-(2-(1-hydroxycyclopropyl)-4-((E)-2-methyldec-2-enoyl)-5-oxooxolan-3-yl)-3-((E)-2-methyldec-2-enoyl)furan-2-one |
| 5-(1-hydroxycyclopropyl)-5-[2-(1-hydroxycyclopropyl)-4-[(E)-2-methyldec-2-enoyl]-5-oxooxolan-3-yl]-3-[(E)-2-methyldec-2-enoyl]furan-2-one |
| RefChem:120315 |
| CHEBI:226534 |
| 5-(1-hydroxycyclopropyl)-5-[2-(1-hydroxycyclopropyl)-4-[(E)-2-methyldec-2-enoyl]-5-oxooxolan-3-yl]-3-[(E)-2-methyldec-2-enoyl]uran-2-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.66% | 89.63% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.27% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.51% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.35% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.59% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.35% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.10% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.49% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.35% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.46% | 93.03% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 86.10% | 85.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.50% | 86.33% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.14% | 98.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.50% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.85% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.15% | 93.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.44% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682182 |
| LOTUS | LTS0108917 |
| wikiData | Q105254402 |