Bipolaricin E
| Internal ID | 739927e2-d34f-4959-8764-c6115d71e7c6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids > Ophiobolane sesterterpenoids |
| IUPAC Name | (1'R,2S,3S,3'S,4'R,5R,7'S,11'R)-8'-(hydroxymethyl)-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)spiro[oxolane-2,12'-tricyclo[9.3.0.03,7]tetradec-8-ene]-4'-ol |
| SMILES (Canonical) | CC1CC(OC12CCC3(C2CC=C(C4CCC(C4C3)(C)O)CO)C)C=C(C)C |
| SMILES (Isomeric) | C[C@H]1C[C@@H](O[C@@]12CC[C@]3([C@H]2CC=C([C@H]4CC[C@@]([C@H]4C3)(C)O)CO)C)C=C(C)C |
| InChI | InChI=1S/C25H40O3/c1-16(2)12-19-13-17(3)25(28-19)11-10-23(4)14-21-20(8-9-24(21,5)27)18(15-26)6-7-22(23)25/h6,12,17,19-22,26-27H,7-11,13-15H2,1-5H3/t17-,19-,20+,21-,22+,23+,24+,25-/m0/s1 |
| InChI Key | WPXFKHCSNMMBKO-RWFDJDLMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29774513 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 4.10 |
| (1'R,2S,3S,3'S,4'R,5R,7'S,11'R)-8'-(hydroxymethyl)-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)spiro[oxolane-2,12'-tricyclo[9.3.0.03,7]tetradec-8-ene]-4'-ol |
| (1'R,2S,3S,3'S,4'R,5R,7'S,11'R)-8'-(hydroxymethyl)-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)spiro(oxolane-2,12'-tricyclo(9.3.0.03,7)tetradec-8-ene)-4'-ol |
| RefChem:119942 |
| CHEBI:225630 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.84% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.57% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.10% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.93% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.15% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.05% | 95.93% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.01% | 97.79% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.31% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.70% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.99% | 94.45% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.25% | 96.61% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.37% | 95.89% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.27% | 95.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.99% | 95.38% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.17% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145721272 |
| LOTUS | LTS0212657 |
| wikiData | Q105310242 |