bipinnatone A
Internal ID | 161668f5-3347-4ca9-bbf1-3c690e820823 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
IUPAC Name | 3-[4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phenyl]-1-(2,4,6-trihydroxyphenyl)propan-1-one |
SMILES (Canonical) | CC(=CCCC(=CCCC(=CCC1=C(C=CC(=C1)CCC(=O)C2=C(C=C(C=C2O)O)O)O)C)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C/CC/C(=C/CC1=C(C=CC(=C1)CCC(=O)C2=C(C=C(C=C2O)O)O)O)/C)/C)C |
InChI | InChI=1S/C30H38O5/c1-20(2)7-5-8-21(3)9-6-10-22(4)11-14-24-17-23(12-15-26(24)32)13-16-27(33)30-28(34)18-25(31)19-29(30)35/h7,9,11-12,15,17-19,31-32,34-35H,5-6,8,10,13-14,16H2,1-4H3/b21-9+,22-11+ |
InChI Key | SJBBGMVJNAOUOI-VLURGLOZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H38O5 |
Molecular Weight | 478.60 g/mol |
Exact Mass | 478.27192431 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 8.30 |
CHEBI:65498 |
3-{4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]phenyl}-1-(2,4,6-trihydroxyphenyl)propan-1-one |
CHEMBL525006 |
DTXSID401108207 |
Q27133939 |
1065546-02-2 |
3-[4-Hydroxy-3-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]phenyl]-1-(2,4,6-trihydroxyphenyl)-1-propanone |
3-[4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phenyl]-1-(2,4,6-trihydroxyphenyl)propan-1-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.60% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.52% | 92.08% |
CHEMBL2581 | P07339 | Cathepsin D | 95.93% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.89% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.88% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.13% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.82% | 99.17% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.97% | 96.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.92% | 86.33% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 86.09% | 92.51% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.09% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.72% | 95.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.01% | 96.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.61% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.40% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.39% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boronia bipinnata |
PubChem | 25016410 |
LOTUS | LTS0091893 |
wikiData | Q27133939 |