Biflavonoid-flavone base + 3O and flavone base + 3O + 1Prenyl
| Internal ID | f15ce340-c22e-49f4-b2c7-e6dafb7a3d70 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 8-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
| SMILES (Canonical) | CC(=CCC1=C(C2=C(C(=C1O)C3=C(C=CC(=C3)C4=CC(=O)C5=C(C=C(C=C5O4)O)O)O)OC(=CC2=O)C6=CC=C(C=C6)O)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C2=C(C(=C1O)C3=C(C=CC(=C3)C4=CC(=O)C5=C(C=C(C=C5O4)O)O)O)OC(=CC2=O)C6=CC=C(C=C6)O)O)C |
| InChI | InChI=1S/C35H26O10/c1-16(2)3-9-21-33(42)30(35-32(34(21)43)26(41)15-27(45-35)17-4-7-19(36)8-5-17)22-11-18(6-10-23(22)38)28-14-25(40)31-24(39)12-20(37)13-29(31)44-28/h3-8,10-15,36-39,42-43H,9H2,1-2H3 |
| InChI Key | PFRUIDZIJVQVOR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H26O10 |
| Molecular Weight | 606.60 g/mol |
| Exact Mass | 606.15259702 g/mol |
| Topological Polar Surface Area (TPSA) | 174.00 Ų |
| XlogP | 7.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.00% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.58% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.27% | 89.00% |
| CHEMBL3194 | P02766 | Transthyretin | 95.77% | 90.71% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.53% | 98.35% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.27% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.21% | 94.73% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 93.89% | 91.71% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 93.70% | 91.38% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.90% | 95.64% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 91.66% | 91.23% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 90.80% | 83.57% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.51% | 95.17% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.09% | 98.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.05% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.84% | 94.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 89.83% | 97.28% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.44% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.81% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.64% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.29% | 96.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.38% | 93.10% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.04% | 96.12% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.74% | 86.92% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.80% | 83.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.57% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.76% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calophyllum venulosum |
| PubChem | 10555648 |
| LOTUS | LTS0098279 |
| wikiData | Q105207939 |