2-[[6,14-Dihydroxy-15-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-methyloxane-3,4,5-triol
Internal ID | 108cecc2-2b9e-45e5-a8ff-49fec30364aa |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 2-[[6,14-dihydroxy-15-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC3C4(CC(C(C4(CCC35CC56C2C(C(CC6)O)(C)C)C)C7(CCC(O7)C(C)(C)O)C)O)C)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CC3C4(CC(C(C4(CCC35CC56C2C(C(CC6)O)(C)C)C)C7(CCC(O7)C(C)(C)O)C)O)C)O)O)O |
InChI | InChI=1S/C36H60O9/c1-18-24(39)25(40)26(41)29(43-18)44-20-15-21-33(7)16-19(37)27(34(8)11-10-23(45-34)31(4,5)42)32(33,6)13-14-35(21)17-36(35)12-9-22(38)30(2,3)28(20)36/h18-29,37-42H,9-17H2,1-8H3 |
InChI Key | LMXZSKHOEAQAHJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H60O9 |
Molecular Weight | 636.90 g/mol |
Exact Mass | 636.42373349 g/mol |
Topological Polar Surface Area (TPSA) | 149.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.39% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.22% | 97.25% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 94.73% | 83.57% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 94.07% | 97.31% |
CHEMBL240 | Q12809 | HERG | 93.18% | 89.76% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.37% | 96.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.17% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.90% | 86.33% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.35% | 96.61% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.07% | 95.38% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 89.92% | 95.69% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.43% | 96.77% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.07% | 97.36% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.18% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.98% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.81% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.75% | 95.58% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.37% | 96.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.70% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.23% | 94.45% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 84.01% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.69% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.31% | 92.86% |
CHEMBL1977 | P11473 | Vitamin D receptor | 83.28% | 99.43% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.12% | 96.43% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.75% | 85.31% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.64% | 95.93% |
CHEMBL1741186 | P51449 | Nuclear receptor ROR-gamma | 81.07% | 99.17% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.97% | 92.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.33% | 95.00% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 80.31% | 97.86% |
CHEMBL204 | P00734 | Thrombin | 80.07% | 96.01% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus coluteocarpus |
PubChem | 14730910 |
LOTUS | LTS0094844 |
wikiData | Q105154179 |