3-[4,5-Dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one
Internal ID | 543ecc46-29a7-4060-b020-f24c364307a9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[4,5-dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC)C5=CC=C(C=C5)O)OC6C(C(C(CO6)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC)C5=CC=C(C=C5)O)OC6C(C(C(CO6)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H40O19/c1-11-20(37)24(41)27(44)31(48-11)47-10-18-22(39)25(42)30(52-32-26(43)21(38)16(36)9-46-32)33(50-18)51-29-23(40)19-15(35)7-14(45-2)8-17(19)49-28(29)12-3-5-13(34)6-4-12/h3-8,11,16,18,20-22,24-27,30-39,41-44H,9-10H2,1-2H3 |
InChI Key | OIFYUPKGGZALHH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O19 |
Molecular Weight | 740.70 g/mol |
Exact Mass | 740.21637904 g/mol |
Topological Polar Surface Area (TPSA) | 293.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
![2D Structure of 3-[4,5-Dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one 2D Structure of 3-[4,5-Dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/bf896970-8745-11ee-9c97-690829aa8b8f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.55% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.31% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.24% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.14% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.79% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.13% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.06% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.94% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.34% | 97.36% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.24% | 95.64% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.17% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.59% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.38% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.13% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.32% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.91% | 99.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.62% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.38% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.95% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.60% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.39% | 86.92% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.37% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cestrum nocturnum |
PubChem | 74978368 |
LOTUS | LTS0217859 |
wikiData | Q105192493 |