Betavulgaroside X
Internal ID | 29113eac-7a2c-4455-bad8-f0526958e407 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | 6-[[4,4,6a,6b,14b-pentamethyl-11-methylidene-8a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(C(O4)C(=O)O)O)OC5C(C(C(CO5)O)O)O)O)C)CC=C6C3(CCC7(C6CC(=C)CC7)C(=O)OC8C(C(C(C(O8)CO)O)O)O)C)C)C |
SMILES (Isomeric) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(C(O4)C(=O)O)O)OC5C(C(C(CO5)O)O)O)O)C)CC=C6C3(CCC7(C6CC(=C)CC7)C(=O)OC8C(C(C(C(O8)CO)O)O)O)C)C)C |
InChI | InChI=1S/C46H70O18/c1-20-9-14-46(41(58)64-39-32(53)30(51)29(50)24(18-47)60-39)16-15-44(5)21(22(46)17-20)7-8-26-43(4)12-11-27(42(2,3)25(43)10-13-45(26,44)6)61-40-34(55)35(33(54)36(63-40)37(56)57)62-38-31(52)28(49)23(48)19-59-38/h7,22-36,38-40,47-55H,1,8-19H2,2-6H3,(H,56,57) |
InChI Key | BOUDARFVWGDGSN-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C46H70O18 |
Molecular Weight | 911.00 g/mol |
Exact Mass | 910.45621538 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | 1.50 |
CHEBI:184457 |
6-[[4,4,6a,6b,14b-pentamethyl-11-methylidene-8a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid |
6-{[4,4,6a,6b,14b-pentamethyl-11-methylidene-8a-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}carbonyl)-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-3,5-dihydroxy-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxane-2-carboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.35% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.48% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.51% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.72% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.97% | 86.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.09% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.09% | 97.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.89% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 85.67% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.23% | 97.09% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.32% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.35% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.06% | 93.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.51% | 99.17% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.46% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.35% | 92.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.10% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.74% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.71% | 97.36% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.25% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Beta vulgaris |
PubChem | 85287103 |
LOTUS | LTS0214364 |
wikiData | Q104940667 |