Betavulgaroside II
Internal ID | 8731a694-bc92-46b0-b728-bad81dd68e47 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 7-[(8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl)oxy]-2-(carboxymethoxy)-3,8-dihydroxy-2,4a,5,7,8,8a-hexahydropyrano[3,4-b][1,4]dioxine-3,5-dicarboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C7C(C(O6)C(=O)O)OC(C(O7)OCC(=O)O)(C(=O)O)O)O)C)C)C2C1)C)C(=O)O)C |
SMILES (Isomeric) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C7C(C(O6)C(=O)O)OC(C(O7)OCC(=O)O)(C(=O)O)O)O)C)C)C2C1)C)C(=O)O)C |
InChI | InChI=1S/C41H60O15/c1-35(2)14-16-40(32(47)48)17-15-38(6)20(21(40)18-35)8-9-23-37(5)12-11-24(36(3,4)22(37)10-13-39(23,38)7)53-31-26(44)27-28(29(54-31)30(45)46)56-41(51,33(49)50)34(55-27)52-19-25(42)43/h8,21-24,26-29,31,34,44,51H,9-19H2,1-7H3,(H,42,43)(H,45,46)(H,47,48)(H,49,50) |
InChI Key | JZICHZJWNUYONS-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C41H60O15 |
Molecular Weight | 792.90 g/mol |
Exact Mass | 792.39322120 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | 4.90 |
CHEBI:184425 |
7-[(8a-Carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl)oxy]-2-(carboxymethoxy)-3,8-dihydroxy-hexahydro-2H-pyrano[3,4-b][1,4]dioxine-3,5-dicarboxylic acid |
7-[(8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl)oxy]-2-(carboxymethoxy)-3,8-dihydroxy-2,4a,5,7,8,8a-hexahydropyrano[3,4-b][1,4]dioxine-3,5-dicarboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.74% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.69% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.60% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.97% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.83% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.75% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.39% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.68% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.62% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.24% | 91.19% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.72% | 96.77% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.63% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.41% | 86.33% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.71% | 95.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.52% | 92.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.46% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.50% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Beta vulgaris |
PubChem | 78422615 |
LOTUS | LTS0074423 |
wikiData | Q105137412 |