beta-Pompilidotoxin
| Internal ID | d55b9222-4a85-46f5-920d-55c31a40e1e0 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[2-[[(2S,3S)-2-[[(2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]hexanoyl]amino]-3-methylpentanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-4-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CCCCN)C(=O)NC(C(C)CC)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(=O)N)NC(=O)C(CCCN=C(N)N)N |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)N)NC(=O)[C@H](CCCN=C(N)N)N |
| InChI | InChI=1S/C71H124N22O17/c1-11-40(9)56(93-62(103)44(23-16-17-27-72)86-69(110)57(41(10)12-2)92-59(100)43(73)22-18-28-80-70(76)77)68(109)82-35-54(96)83-48(31-38(5)6)63(104)89-50(33-42-20-14-13-15-21-42)65(106)90-51(34-55(97)98)66(107)85-46(25-26-53(74)95)61(102)88-49(32-39(7)8)64(105)91-52(36-94)67(108)84-45(24-19-29-81-71(78)79)60(101)87-47(58(75)99)30-37(3)4/h13-15,20-21,37-41,43-52,56-57,94H,11-12,16-19,22-36,72-73H2,1-10H3,(H2,74,95)(H2,75,99)(H,82,109)(H,83,96)(H,84,108)(H,85,107)(H,86,110)(H,87,101)(H,88,102)(H,89,104)(H,90,106)(H,91,105)(H,92,100)(H,93,103)(H,97,98)(H4,76,77,80)(H4,78,79,81)/t40-,41-,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,56-,57-/m0/s1 |
| InChI Key | YBOJYGJMKPMNRC-QRIWDNSUSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C71H124N22O17 |
| Molecular Weight | 1557.90 g/mol |
| Exact Mass | 1556.95148058 g/mol |
| Topological Polar Surface Area (TPSA) | 674.00 Ų |
| XlogP | -4.60 |
| Atomic LogP (AlogP) | -5.31 |
| H-Bond Acceptor | 20 |
| H-Bond Donor | 22 |
| Rotatable Bonds | 55 |
| 216064-36-7 |
| RIKIGLFDQLSRL |
| -Pompilidotoxin |
| ?-Pompilidotoxin |
| ?-PMTX |
| CHEMBL4450634 |
| AKOS024456654 |
| PD079057 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8590 | 85.90% |
| Caco-2 | - | 0.8660 | 86.60% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Mitochondria | 0.6903 | 69.03% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8542 | 85.42% |
| OATP1B3 inhibitior | + | 0.9373 | 93.73% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | - | 0.7250 | 72.50% |
| BSEP inhibitior | + | 0.9631 | 96.31% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8668 | 86.68% |
| CYP3A4 substrate | + | 0.7024 | 70.24% |
| CYP2C9 substrate | - | 0.5964 | 59.64% |
| CYP2D6 substrate | - | 0.8113 | 81.13% |
| CYP3A4 inhibition | - | 0.7401 | 74.01% |
| CYP2C9 inhibition | - | 0.8427 | 84.27% |
| CYP2C19 inhibition | - | 0.7843 | 78.43% |
| CYP2D6 inhibition | - | 0.8530 | 85.30% |
| CYP1A2 inhibition | - | 0.8749 | 87.49% |
| CYP2C8 inhibition | + | 0.6783 | 67.83% |
| CYP inhibitory promiscuity | - | 0.9712 | 97.12% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.6271 | 62.71% |
| Eye corrosion | - | 0.9861 | 98.61% |
| Eye irritation | - | 0.8956 | 89.56% |
| Skin irritation | - | 0.7996 | 79.96% |
| Skin corrosion | - | 0.9392 | 93.92% |
| Ames mutagenesis | - | 0.7800 | 78.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7175 | 71.75% |
| Micronuclear | + | 0.6100 | 61.00% |
| Hepatotoxicity | - | 0.6239 | 62.39% |
| skin sensitisation | - | 0.8583 | 85.83% |
| Respiratory toxicity | + | 0.8000 | 80.00% |
| Reproductive toxicity | + | 0.7778 | 77.78% |
| Mitochondrial toxicity | + | 0.6750 | 67.50% |
| Nephrotoxicity | - | 0.5956 | 59.56% |
| Acute Oral Toxicity (c) | III | 0.6379 | 63.79% |
| Estrogen receptor binding | + | 0.5312 | 53.12% |
| Androgen receptor binding | + | 0.6929 | 69.29% |
| Thyroid receptor binding | + | 0.7027 | 70.27% |
| Glucocorticoid receptor binding | + | 0.7885 | 78.85% |
| Aromatase binding | + | 0.8015 | 80.15% |
| PPAR gamma | + | 0.7394 | 73.94% |
| Honey bee toxicity | - | 0.8076 | 80.76% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
| Fish aquatic toxicity | + | 0.8035 | 80.35% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.38% | 96.61% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 99.32% | 90.20% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.79% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.46% | 96.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.25% | 97.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.11% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 97.43% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.30% | 99.17% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.15% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.09% | 98.33% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 96.94% | 98.94% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 94.82% | 96.67% |
| CHEMBL236 | P41143 | Delta opioid receptor | 94.71% | 99.35% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.56% | 97.21% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.51% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.89% | 96.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 93.61% | 88.42% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.77% | 98.05% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.52% | 93.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.34% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.46% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.41% | 90.71% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 89.00% | 100.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 88.19% | 96.85% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.70% | 89.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.29% | 98.75% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 87.09% | 96.37% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 86.81% | 97.64% |
| CHEMBL3776 | Q14790 | Caspase-8 | 86.77% | 97.06% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.32% | 89.63% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.32% | 91.71% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 86.30% | 96.67% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.20% | 83.82% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 85.98% | 98.33% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 85.60% | 98.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.46% | 82.69% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 85.36% | 86.67% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.32% | 96.47% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.10% | 93.18% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.91% | 87.45% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.14% | 91.81% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.06% | 94.73% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.48% | 96.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.99% | 95.89% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.99% | 95.38% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.75% | 98.10% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.36% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.14% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 90479801 |
| LOTUS | LTS0175541 |
| wikiData | Q105345957 |