beta-Artemether
Internal ID | 91fba35a-fee0-4891-ac39-c312cc8e01c0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Artemisinins |
IUPAC Name | (4S,5R,8S,9R,10S,12R,13R)-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
SMILES (Canonical) | CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)OC)C |
SMILES (Isomeric) | C[C@@H]1CC[C@H]2[C@H]([C@H](O[C@H]3[C@@]24[C@H]1CCC(O3)(OO4)C)OC)C |
InChI | InChI=1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15?,16-/m1/s1 |
InChI Key | SXYIRMFQILZOAM-GXTLMGRASA-N |
Popularity | 1,065 references in papers |
Molecular Formula | C16H26O5 |
Molecular Weight | 298.37 g/mol |
Exact Mass | 298.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 46.20 Ų |
XlogP | 3.10 |
Artemether [INN] |
Artemether (SM-224) |
Larither |
Arteannuin ether |
.beta.-Artemether |
C7D6T3H22J |
ss-Artemether |
C16-H26-O5 |
NSC-665970 |
NSC-759820 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293235 | P02545 | Prelamin-A/C |
562.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.36% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.28% | 97.25% |
CHEMBL240 | Q12809 | HERG | 89.12% | 89.76% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.60% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.31% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.87% | 97.14% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 86.53% | 97.31% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 86.26% | 97.53% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.03% | 96.43% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.80% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.77% | 94.45% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 83.80% | 98.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.06% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.75% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.18% | 100.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.17% | 94.80% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.87% | 91.03% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.01% | 96.38% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.96% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.07% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia annua |
Artemisia carvifolia |