Benzyl 2-hydroxy-5-methoxybenzoate
Internal ID | d6d4950a-d73b-49dd-ad3e-73c83d4f35e4 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Methoxybenzoic acids and derivatives > M-methoxybenzoic acids and derivatives |
IUPAC Name | benzyl 2-hydroxy-5-methoxybenzoate |
SMILES (Canonical) | COC1=CC(=C(C=C1)O)C(=O)OCC2=CC=CC=C2 |
SMILES (Isomeric) | COC1=CC(=C(C=C1)O)C(=O)OCC2=CC=CC=C2 |
InChI | InChI=1S/C15H14O4/c1-18-12-7-8-14(16)13(9-12)15(17)19-10-11-5-3-2-4-6-11/h2-9,16H,10H2,1H3 |
InChI Key | GZYORCWEKZDWCP-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C15H14O4 |
Molecular Weight | 258.27 g/mol |
Exact Mass | 258.08920892 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 3.40 |
SCHEMBL7719669 |
GZYORCWEKZDWCP-UHFFFAOYSA-N |
AKOS000901937 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.61% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.57% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.10% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.14% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.66% | 99.15% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.34% | 90.17% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 93.13% | 92.67% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.12% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.03% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.53% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.45% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 88.30% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.04% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.94% | 94.73% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.05% | 91.71% |
CHEMBL3891 | P07384 | Calpain 1 | 80.32% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Desmos chinensis |
Uvaria grandiflora |
PubChem | 7430404 |
LOTUS | LTS0055059 |
wikiData | Q105024728 |