Benzoyleugenol
Internal ID | 50ed2f16-92d8-42a1-bb56-d55aabfbfb51 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzophenones |
IUPAC Name | (2-hydroxy-3-methoxy-5-prop-2-enylphenyl)-phenylmethanone |
SMILES (Canonical) | COC1=CC(=CC(=C1O)C(=O)C2=CC=CC=C2)CC=C |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)C(=O)C2=CC=CC=C2)CC=C |
InChI | InChI=1S/C17H16O3/c1-3-7-12-10-14(17(19)15(11-12)20-2)16(18)13-8-5-4-6-9-13/h3-6,8-11,19H,1,7H2,2H3 |
InChI Key | MRKBPQPAZNBFFC-UHFFFAOYSA-N |
Popularity | 20 references in papers |
Molecular Formula | C17H16O3 |
Molecular Weight | 268.31 g/mol |
Exact Mass | 268.109944368 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.31% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 95.19% | 95.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 94.31% | 90.20% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.15% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.07% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.03% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.91% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.42% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.15% | 95.17% |
CHEMBL2535 | P11166 | Glucose transporter | 88.86% | 98.75% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.72% | 91.07% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.62% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.12% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hedychium coronarium |
PubChem | 129638709 |
LOTUS | LTS0207841 |
wikiData | Q104399921 |