Benzo(c)(2,7)naphthyridin-4(3H)-one
| Internal ID | 04c841a1-dfb0-4199-bb18-2a1168f03b32 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Naphthyridines |
| IUPAC Name | 3H-benzo[f][2,7]naphthyridin-4-one |
| SMILES (Canonical) | C1=CC=C2C(=C1)C3=C(C=N2)C(=O)NC=C3 |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C3=C(C=N2)C(=O)NC=C3 |
| InChI | InChI=1S/C12H8N2O/c15-12-10-7-14-11-4-2-1-3-9(11)8(10)5-6-13-12/h1-7H,(H,13,15) |
| InChI Key | ULIAUQBOGQCMQM-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.063662883 g/mol |
| Topological Polar Surface Area (TPSA) | 42.00 Ų |
| XlogP | 1.60 |
| 7344-61-8 |
| Benzo(c)(2,7)naphthyridin-4(3H)-one |
| CHEMBL4162200 |
| DTXSID50223666 |
| NSC756043 |
| NSC-756043 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.34% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.43% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.17% | 91.11% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 90.05% | 92.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.99% | 98.75% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.89% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.97% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.43% | 89.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.36% | 90.08% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.25% | 94.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.96% | 88.56% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 83.12% | 96.47% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.87% | 98.59% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.21% | 97.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.18% | 93.99% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.41% | 80.71% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.26% | 94.62% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.10% | 97.64% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.23% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycine max |
| PubChem | 5748566 |
| LOTUS | LTS0132169 |
| wikiData | Q83102135 |