Benzenepropanoic acid, 2-butyl ester
Internal ID | 2983006a-dc6b-4d62-99bd-c01392bfe0ba |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters |
IUPAC Name | butan-2-yl 3-phenylpropanoate |
SMILES (Canonical) | CCC(C)OC(=O)CCC1=CC=CC=C1 |
SMILES (Isomeric) | CCC(C)OC(=O)CCC1=CC=CC=C1 |
InChI | InChI=1S/C13H18O2/c1-3-11(2)15-13(14)10-9-12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3 |
InChI Key | WSCMURDYEUVWJE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H18O2 |
Molecular Weight | 206.28 g/mol |
Exact Mass | 206.130679813 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 3.30 |
WSCMURDYEUVWJE-UHFFFAOYSA-N |
Benzenepropanoic acid, 2-butyl ester |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.15% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.31% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.13% | 99.17% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.75% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.59% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.55% | 95.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.22% | 94.62% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.64% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.61% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Baccharis dracunculifolia |
PubChem | 562005 |
LOTUS | LTS0071153 |
wikiData | Q104667234 |