Benzenemethanol, 2-methoxy-, benzoate
| Internal ID | f4f8bb46-385f-48e7-b341-df202d732e8c |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzoic acid esters |
| IUPAC Name | (2-methoxyphenyl)methyl benzoate |
| SMILES (Canonical) | COC1=CC=CC=C1COC(=O)C2=CC=CC=C2 |
| SMILES (Isomeric) | COC1=CC=CC=C1COC(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C15H14O3/c1-17-14-10-6-5-9-13(14)11-18-15(16)12-7-3-2-4-8-12/h2-10H,11H2,1H3 |
| InChI Key | BZUHSQFJABFAHL-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 3.20 |
| 2-Methoxybenzyl benzoate |
| Benzenemethanol, 2-methoxy-, benzoate |
| CHEMBL498647 |
| 64421-25-6 |
| SCHEMBL6667180 |
| DTXSID50214675 |
| BDBM50479171 |
| AKOS017016428 |
| Q63392251 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.55% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.50% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.30% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.51% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.41% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.77% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.51% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.45% | 96.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.81% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.74% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.11% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aniba ferrea |
| Balantiopsis rosea |
| Desmos chinensis |
| Desmos cochinchinensis |
| Uvaria chamae |
| Uvaria grandiflora |
| Uvaria rufa |
| PubChem | 3085295 |
| LOTUS | LTS0264146 |
| wikiData | Q105228204 |