(2R)-6-amino-2-[[(1S,4R,10R,19S,22R,25R,28S,31R,34S,37S,43R,46R,47S,50S,53S,56S,62S)-50-amino-43-(2-amino-2-oxoethyl)-56-(3-amino-3-oxopropyl)-10-benzyl-37-(carboxymethyl)-31-(hydroxymethyl)-28-(1H-indol-3-ylmethyl)-47,62-dimethyl-7-methylidene-22-(2-methylpropyl)-2,5,8,11,14,20,23,26,29,32,35,38,41,44,51,54,57-heptadecaoxo-53-propan-2-yl-48,60,63-trithia-3,6,9,12,15,21,24,27,30,33,36,39,42,45,52,55,58-heptadecazatetracyclo[32.24.3.34,25.015,19]tetrahexacontane-46-carbonyl]amino]hexanoic acid
| Internal ID | 88d0e94a-94a7-4b05-878b-51619a113cd1 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2R)-6-amino-2-[[(1S,4R,10R,19S,22R,25R,28S,31R,34S,37S,43R,46R,47S,50S,53S,56S,62S)-50-amino-43-(2-amino-2-oxoethyl)-56-(3-amino-3-oxopropyl)-10-benzyl-37-(carboxymethyl)-31-(hydroxymethyl)-28-(1H-indol-3-ylmethyl)-47,62-dimethyl-7-methylidene-22-(2-methylpropyl)-2,5,8,11,14,20,23,26,29,32,35,38,41,44,51,54,57-heptadecaoxo-53-propan-2-yl-48,60,63-trithia-3,6,9,12,15,21,24,27,30,33,36,39,42,45,52,55,58-heptadecazatetracyclo[32.24.3.34,25.015,19]tetrahexacontane-46-carbonyl]amino]hexanoic acid |
| SMILES (Canonical) | CC1C2C(=O)NC(C(=O)NC(C(=O)NC3CSCC(C(=O)NC(CS1)C(=O)NC(=C)C(=O)NC(C(=O)NCC(=O)N4CCCC4C(=O)NC(C(=O)N2)CC(C)C)CC5=CC=CC=C5)NC(=O)C(NC(=O)C(NC(=O)C(CSC(C(NC(=O)C(NC(=O)CNC(=O)C(NC3=O)CC(=O)O)CC(=O)N)C(=O)NC(CCCCN)C(=O)O)C)N)C(C)C)CCC(=O)N)CO)CC6=CNC7=CC=CC=C76 |
| SMILES (Isomeric) | C[C@H]1[C@H]2C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@@H]3CSC[C@H](C(=O)N[C@@H](CS1)C(=O)NC(=C)C(=O)N[C@@H](C(=O)NCC(=O)N4CCC[C@H]4C(=O)N[C@@H](C(=O)N2)CC(C)C)CC5=CC=CC=C5)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](CS[C@H]([C@H](NC(=O)[C@H](NC(=O)CNC(=O)[C@@H](NC3=O)CC(=O)O)CC(=O)N)C(=O)N[C@H](CCCCN)C(=O)O)C)N)C(C)C)CCC(=O)N)CO)CC6=CNC7=CC=CC=C76 |
| InChI | InChI=1S/C85H121N23O25S3/c1-39(2)26-51-75(122)106-68-43(7)136-38-59(78(125)93-41(5)69(116)97-52(27-44-16-9-8-10-17-44)71(118)92-33-64(113)108-25-15-21-60(108)81(128)99-51)104-80(127)58-37-134-36-57(103-77(124)56(34-109)101-74(121)53(100-84(68)131)28-45-31-90-48-19-12-11-18-46(45)48)79(126)98-55(30-65(114)115)72(119)91-32-63(112)94-54(29-62(89)111)76(123)107-67(83(130)96-50(85(132)133)20-13-14-24-86)42(6)135-35-47(87)70(117)105-66(40(3)4)82(129)95-49(73(120)102-58)22-23-61(88)110/h8-12,16-19,31,39-40,42-43,47,49-60,66-68,90,109H,5,13-15,20-30,32-38,86-87H2,1-4,6-7H3,(H2,88,110)(H2,89,111)(H,91,119)(H,92,118)(H,93,125)(H,94,112)(H,95,129)(H,96,130)(H,97,116)(H,98,126)(H,99,128)(H,100,131)(H,101,121)(H,102,120)(H,103,124)(H,104,127)(H,105,117)(H,106,122)(H,107,123)(H,114,115)(H,132,133)/t42-,43-,47+,49-,50+,51+,52+,53-,54+,55-,56+,57+,58+,59-,60-,66-,67-,68-/m0/s1 |
| InChI Key | DEEOVDONDDERBX-XDJJBTLASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C85H121N23O25S3 |
| Molecular Weight | 1961.20 g/mol |
| Exact Mass | 1959.8066100 g/mol |
| Topological Polar Surface Area (TPSA) | 840.00 Ų |
| XlogP | -8.90 |
| Atomic LogP (AlogP) | -8.54 |
| H-Bond Acceptor | 28 |
| H-Bond Donor | 25 |
| Rotatable Bonds | 22 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8454 | 84.54% |
| Caco-2 | - | 0.8608 | 86.08% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.7429 | 74.29% |
| Subcellular localzation | Mitochondria | 0.4018 | 40.18% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8174 | 81.74% |
| OATP1B3 inhibitior | + | 0.9272 | 92.72% |
| MATE1 inhibitior | - | 0.7694 | 76.94% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9668 | 96.68% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8776 | 87.76% |
| CYP3A4 substrate | + | 0.7638 | 76.38% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8410 | 84.10% |
| CYP3A4 inhibition | - | 0.7974 | 79.74% |
| CYP2C9 inhibition | - | 0.8046 | 80.46% |
| CYP2C19 inhibition | - | 0.7728 | 77.28% |
| CYP2D6 inhibition | - | 0.8978 | 89.78% |
| CYP1A2 inhibition | - | 0.8429 | 84.29% |
| CYP2C8 inhibition | + | 0.8433 | 84.33% |
| CYP inhibitory promiscuity | - | 0.8634 | 86.34% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5598 | 55.98% |
| Eye corrosion | - | 0.9847 | 98.47% |
| Eye irritation | - | 0.8952 | 89.52% |
| Skin irritation | - | 0.7559 | 75.59% |
| Skin corrosion | - | 0.9191 | 91.91% |
| Ames mutagenesis | - | 0.6300 | 63.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7101 | 71.01% |
| Micronuclear | + | 0.8100 | 81.00% |
| Hepatotoxicity | - | 0.5875 | 58.75% |
| skin sensitisation | - | 0.8443 | 84.43% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.9875 | 98.75% |
| Nephrotoxicity | - | 0.7066 | 70.66% |
| Acute Oral Toxicity (c) | III | 0.5871 | 58.71% |
| Estrogen receptor binding | - | 0.5760 | 57.60% |
| Androgen receptor binding | + | 0.7250 | 72.50% |
| Thyroid receptor binding | + | 0.8296 | 82.96% |
| Glucocorticoid receptor binding | + | 0.8572 | 85.72% |
| Aromatase binding | + | 0.8285 | 82.85% |
| PPAR gamma | + | 0.7832 | 78.32% |
| Honey bee toxicity | - | 0.6103 | 61.03% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.9902 | 99.02% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.92% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.91% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.62% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.47% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.83% | 97.64% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.94% | 85.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.87% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.84% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.46% | 94.45% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.35% | 88.56% |
| CHEMBL4071 | P08311 | Cathepsin G | 96.82% | 94.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.69% | 90.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.69% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.79% | 97.14% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.78% | 95.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.31% | 90.20% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.62% | 95.89% |
| CHEMBL228 | P31645 | Serotonin transporter | 93.47% | 95.51% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.42% | 97.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.33% | 98.33% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 93.12% | 96.67% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.98% | 95.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.82% | 96.90% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.72% | 96.31% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 92.69% | 88.42% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 92.67% | 82.38% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 92.65% | 96.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.25% | 97.25% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 92.15% | 96.25% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 89.75% | 83.10% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 89.50% | 98.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.41% | 100.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 88.87% | 82.86% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.62% | 95.83% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.35% | 92.97% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.86% | 93.03% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 86.39% | 85.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.15% | 94.62% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.79% | 82.69% |
| CHEMBL3837 | P07711 | Cathepsin L | 85.67% | 96.61% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 85.54% | 90.71% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 85.37% | 85.83% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 85.29% | 80.71% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.96% | 92.32% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.78% | 93.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.77% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.99% | 94.66% |
| CHEMBL2821 | P00748 | Coagulation factor XII | 82.76% | 96.21% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.74% | 99.18% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.62% | 91.71% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.18% | 96.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.17% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.03% | 99.23% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 81.97% | 88.10% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.72% | 97.29% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.18% | 98.59% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 81.11% | 94.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.03% | 94.08% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.04% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589045 |
| LOTUS | LTS0231434 |
| wikiData | Q83118994 |