[(2S,3R,4R,5S,6S)-3-acetyloxy-5-hydroxy-2-[(14-hydroxy-6,13-dimethoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-6-methyloxan-4-yl] acetate
| Internal ID | 78135f13-1c48-46f1-807e-93ed71f7f7d6 |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | [(2S,3R,4R,5S,6S)-3-acetyloxy-5-hydroxy-2-[(14-hydroxy-6,13-dimethoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-6-methyloxan-4-yl] acetate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C=C3C4=C2OC(=O)C5=CC(=C(C(=C54)OC3=O)O)OC)OC)OC(=O)C)OC(=O)C)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(C=C3C4=C2OC(=O)C5=CC(=C(C(=C54)OC3=O)O)OC)OC)OC(=O)C)OC(=O)C)O |
| InChI | InChI=1S/C26H24O14/c1-8-17(29)22(36-9(2)27)23(37-10(3)28)26(35-8)40-19-14(34-5)7-12-16-15-11(25(32)39-21(16)19)6-13(33-4)18(30)20(15)38-24(12)31/h6-8,17,22-23,26,29-30H,1-5H3/t8-,17-,22+,23+,26-/m0/s1 |
| InChI Key | GQJAWLOFGSZVBK-JSQOIUDGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H24O14 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.11660544 g/mol |
| Topological Polar Surface Area (TPSA) | 183.00 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of [(2S,3R,4R,5S,6S)-3-acetyloxy-5-hydroxy-2-[(14-hydroxy-6,13-dimethoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-6-methyloxan-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/bed07130-85e4-11ee-bfff-1be9f0ae82e8.jpg "2D Structure of [(2S,3R,4R,5S,6S)-3-acetyloxy-5-hydroxy-2-[(14-hydroxy-6,13-dimethoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-6-methyloxan-4-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.03% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.27% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.53% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.14% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.82% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.50% | 86.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.52% | 94.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.75% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.40% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.23% | 91.49% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.30% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.00% | 99.23% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.62% | 95.89% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.58% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.38% | 91.19% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.85% | 92.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.77% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Elaeocarpus mastersii |
| PubChem | 11071799 |
| LOTUS | LTS0174191 |
| wikiData | Q105015420 |