(1S,2Z,5R,6E,8S,12R)-1,5-dimethyl-11-methylidene-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6-dien-5-ol
Internal ID | 49fea286-b43e-497d-87b5-fcc26fc087c9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1S,2Z,5R,6E,8S,12R)-1,5-dimethyl-11-methylidene-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6-dien-5-ol |
SMILES (Canonical) | CC(C)C1CCC(=C)C2CCC(O2)(C=CCC(C=C1)(C)O)C |
SMILES (Isomeric) | CC(C)[C@@H]\1CCC(=C)[C@H]2CC[C@](O2)(/C=C\C[C@@](/C=C1)(C)O)C |
InChI | InChI=1S/C20H32O2/c1-15(2)17-8-7-16(3)18-10-14-20(5,22-18)12-6-11-19(4,21)13-9-17/h6,9,12-13,15,17-18,21H,3,7-8,10-11,14H2,1-2,4-5H3/b12-6-,13-9+/t17-,18-,19-,20-/m1/s1 |
InChI Key | SOCRUWBAQPJTHY-AMRVLNSDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H32O2 |
Molecular Weight | 304.50 g/mol |
Exact Mass | 304.240230259 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 4.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.82% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.65% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.00% | 97.25% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 91.97% | 92.51% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.01% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.35% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.56% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.91% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.76% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.79% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.48% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.90% | 92.62% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.65% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana sylvestris |
PubChem | 162873813 |
LOTUS | LTS0078894 |
wikiData | Q105256847 |