10-(4,5-dihydroxy-6-methyl-3-sulfooxyoxan-2-yl)oxy-1,2,6b,9,9,12a-hexamethyl-4a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-6a-carboxylic acid
Internal ID | 73ed272e-b0bd-4f46-adb8-2899be1e6337 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 10-(4,5-dihydroxy-6-methyl-3-sulfooxyoxan-2-yl)oxy-1,2,6b,9,9,12a-hexamethyl-4a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-6a-carboxylic acid |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)C)O)O)OS(=O)(=O)O)C)C)C2C1C)C(=O)O)C(=O)OC7C(C(C(C(O7)CO)O)O)O |
SMILES (Isomeric) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)C)O)O)OS(=O)(=O)O)C)C)C2C1C)C(=O)O)C(=O)OC7C(C(C(C(O7)CO)O)O)O |
InChI | InChI=1S/C42H66O17S/c1-19-10-15-41(37(51)58-34-32(48)30(46)29(45)23(18-43)56-34)16-17-42(36(49)50)22(27(41)20(19)2)8-9-25-39(6)13-12-26(38(4,5)24(39)11-14-40(25,42)7)57-35-33(59-60(52,53)54)31(47)28(44)21(3)55-35/h8,19-21,23-35,43-48H,9-18H2,1-7H3,(H,49,50)(H,52,53,54) |
InChI Key | DDVZERLQXNLWHT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H66O17S |
Molecular Weight | 875.00 g/mol |
Exact Mass | 874.40207181 g/mol |
Topological Polar Surface Area (TPSA) | 285.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
![2D Structure of 10-(4,5-dihydroxy-6-methyl-3-sulfooxyoxan-2-yl)oxy-1,2,6b,9,9,12a-hexamethyl-4a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-6a-carboxylic acid 2D Structure of 10-(4,5-dihydroxy-6-methyl-3-sulfooxyoxan-2-yl)oxy-1,2,6b,9,9,12a-hexamethyl-4a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-6a-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/bdf398d0-8639-11ee-917d-058137b890d0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.41% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.58% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.19% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.13% | 97.36% |
CHEMBL2581 | P07339 | Cathepsin D | 90.66% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.37% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.49% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.41% | 97.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.61% | 92.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.93% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.61% | 95.83% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.84% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.08% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.22% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.10% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.27% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.95% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.07% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zygophyllum fabago |
PubChem | 163052358 |
LOTUS | LTS0136370 |
wikiData | Q104976968 |