(2R,3S,4S)-4-[[(2R,3S,4S)-4-[[(2R)-3-amino-2-[[(2R,3R,4R,6R)-3-hydroxy-2,4,6-trimethyloctanoyl]amino]propanoyl]amino]-2,3,5-trihydroxy-5-methylhexanoyl]amino]-N'-[(3S,6R,9R,12S,15S,18S,21R,24R,25R)-9-[(1S)-2-amino-1-methoxy-2-oxoethyl]-6-(2-amino-2-oxoethyl)-12-(3-amino-3-oxopropyl)-18-(3-aminopropyl)-21-[(1R)-1-hydroxyethyl]-4,13,25-trimethyl-3,15-bis(2-methylpropyl)-2,5,8,11,14,17,20,23-octaoxo-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-24-yl]-2,3-dimethylpentanediamide
| Internal ID | df6eb058-1980-4b5a-8f45-f520128f3bec |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R,3S,4S)-4-[[(2R,3S,4S)-4-[[(2R)-3-amino-2-[[(2R,3R,4R,6R)-3-hydroxy-2,4,6-trimethyloctanoyl]amino]propanoyl]amino]-2,3,5-trihydroxy-5-methylhexanoyl]amino]-N'-[(3S,6R,9R,12S,15S,18S,21R,24R,25R)-9-[(1S)-2-amino-1-methoxy-2-oxoethyl]-6-(2-amino-2-oxoethyl)-12-(3-amino-3-oxopropyl)-18-(3-aminopropyl)-21-[(1R)-1-hydroxyethyl]-4,13,25-trimethyl-3,15-bis(2-methylpropyl)-2,5,8,11,14,17,20,23-octaoxo-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-24-yl]-2,3-dimethylpentanediamide |
| SMILES (Canonical) | CCC(C)CC(C)C(C(C)C(=O)NC(CN)C(=O)NC(C(C(C(=O)NC(C(C)C(C)C(=O)N)C(=O)NC1C(OC(=O)C(N(C(=O)C(NC(=O)C(NC(=O)C(N(C(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)O)CCCN)CC(C)C)C)CCC(=O)N)C(C(=O)N)OC)CC(=O)N)C)CC(C)C)C)O)O)C(C)(C)O)O |
| SMILES (Isomeric) | CC[C@@H](C)C[C@@H](C)[C@H]([C@@H](C)C(=O)N[C@H](CN)C(=O)N[C@@H]([C@@H]([C@H](C(=O)N[C@@H]([C@@H](C)[C@@H](C)C(=O)N)C(=O)N[C@@H]1[C@H](OC(=O)[C@@H](N(C(=O)[C@H](NC(=O)[C@H](NC(=O)[C@@H](N(C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC1=O)[C@@H](C)O)CCCN)CC(C)C)C)CCC(=O)N)[C@@H](C(=O)N)OC)CC(=O)N)C)CC(C)C)C)O)O)C(C)(C)O)O |
| InChI | InChI=1S/C69H123N17O23/c1-18-31(6)26-32(7)50(90)35(10)57(95)79-41(28-71)59(97)84-54(69(13,14)107)51(91)52(92)65(103)80-46(33(8)34(9)55(74)93)61(99)82-48-37(12)109-68(106)43(25-30(4)5)86(16)67(105)40(27-45(73)89)78-64(102)49(53(108-17)56(75)94)83-60(98)42(21-22-44(72)88)85(15)66(104)39(24-29(2)3)77-58(96)38(20-19-23-70)76-62(100)47(36(11)87)81-63(48)101/h29-43,46-54,87,90-92,107H,18-28,70-71H2,1-17H3,(H2,72,88)(H2,73,89)(H2,74,93)(H2,75,94)(H,76,100)(H,77,96)(H,78,102)(H,79,95)(H,80,103)(H,81,101)(H,82,99)(H,83,98)(H,84,97)/t31-,32-,33+,34-,35-,36-,37-,38+,39+,40-,41-,42+,43+,46+,47-,48-,49-,50-,51-,52-,53+,54+/m1/s1 |
| InChI Key | SMXZYGUPQGGYNP-MBNVAABASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C69H123N17O23 |
| Molecular Weight | 1558.80 g/mol |
| Exact Mass | 1557.89777324 g/mol |
| Topological Polar Surface Area (TPSA) | 664.00 Ų |
| XlogP | -4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.85% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.52% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.26% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.49% | 97.25% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 98.02% | 98.59% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 97.96% | 97.31% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 97.80% | 98.05% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.31% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.34% | 99.17% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 95.12% | 95.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.75% | 91.11% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 94.38% | 89.50% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.80% | 95.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.75% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.48% | 95.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.71% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.36% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.13% | 97.29% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 92.09% | 88.42% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.48% | 98.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.86% | 97.09% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.73% | 94.66% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.55% | 96.90% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.44% | 92.29% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.20% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.86% | 86.33% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.56% | 96.11% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.52% | 92.88% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.61% | 93.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.34% | 99.23% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.32% | 94.33% |
| CHEMBL1949 | P62937 | Cyclophilin A | 85.97% | 98.57% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.66% | 97.64% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.28% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.53% | 94.45% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 84.48% | 96.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.31% | 96.00% |
| CHEMBL1801 | P00747 | Plasminogen | 83.59% | 92.44% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 83.40% | 94.50% |
| CHEMBL5028 | O14672 | ADAM10 | 82.84% | 97.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.74% | 91.19% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 82.08% | 90.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.62% | 90.08% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 80.64% | 95.20% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 80.22% | 95.27% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.19% | 95.93% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 80.09% | 81.58% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163071182 |
| LOTUS | LTS0122955 |
| wikiData | Q105256236 |