6-Ethenyl-6,10-dihydroxy-1,11-dimethyl-5-methylidene-13-oxatetracyclo[8.6.0.02,8.011,14]hexadecane-7,12-dione
| Internal ID | 56d3b151-972c-4428-903d-359f178a3ba9 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
| IUPAC Name | 6-ethenyl-6,10-dihydroxy-1,11-dimethyl-5-methylidene-13-oxatetracyclo[8.6.0.02,8.011,14]hexadecane-7,12-dione |
| SMILES (Canonical) | CC12CCC3C(C1(CC4C2CCC(=C)C(C4=O)(C=C)O)O)(C(=O)O3)C |
| SMILES (Isomeric) | CC12CCC3C(C1(CC4C2CCC(=C)C(C4=O)(C=C)O)O)(C(=O)O3)C |
| InChI | InChI=1S/C20H26O5/c1-5-19(23)11(2)6-7-13-12(15(19)21)10-20(24)17(13,3)9-8-14-18(20,4)16(22)25-14/h5,12-14,23-24H,1-2,6-10H2,3-4H3 |
| InChI Key | YTTDANAUSIFBOM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.45% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.30% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.03% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.97% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.65% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.21% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.79% | 96.09% |
| CHEMBL240 | Q12809 | HERG | 87.76% | 89.76% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.51% | 97.05% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.86% | 91.07% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.52% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.90% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.43% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.91% | 97.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.90% | 93.03% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.79% | 96.43% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.64% | 94.75% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.51% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.03% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162966008 |
| LOTUS | LTS0125636 |
| wikiData | Q105361970 |