Adipokinetic Hormone (Apis mellifera ligustica, Bombyx mori, Heliothis zea, Manduca sexta) Pyr-Leu-Thr-Phe-Thr-Ser-Ser-Trp-Gly-NH2
Internal ID | 32556ede-2114-46c7-a191-cb22e1f71d0a |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
IUPAC Name | N-[1-[[1-[[1-[[1-[[1-[[1-[[1-[(2-amino-2-oxoethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-5-oxopyrrolidine-2-carboxamide |
SMILES (Canonical) | CC(C)CC(C(=O)NC(C(C)O)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(C(C)O)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)NCC(=O)N)NC(=O)C4CCC(=O)N4 |
SMILES (Isomeric) | CC(C)CC(C(=O)NC(C(C)O)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(C(C)O)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)NCC(=O)N)NC(=O)C4CCC(=O)N4 |
InChI | InChI=1S/C47H65N11O14/c1-23(2)16-31(52-41(66)30-14-15-37(64)51-30)42(67)57-38(24(3)61)46(71)54-32(17-26-10-6-5-7-11-26)43(68)58-39(25(4)62)47(72)56-35(22-60)45(70)55-34(21-59)44(69)53-33(40(65)50-20-36(48)63)18-27-19-49-29-13-9-8-12-28(27)29/h5-13,19,23-25,30-35,38-39,49,59-62H,14-18,20-22H2,1-4H3,(H2,48,63)(H,50,65)(H,51,64)(H,52,66)(H,53,69)(H,54,71)(H,55,70)(H,56,72)(H,57,67)(H,58,68) |
InChI Key | JWRLBCPURJXBDR-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C47H65N11O14 |
Molecular Weight | 1008.10 g/mol |
Exact Mass | 1007.47124579 g/mol |
Topological Polar Surface Area (TPSA) | 402.00 Ų |
XlogP | -2.60 |
Atomic LogP (AlogP) | -4.98 |
H-Bond Acceptor | 14 |
H-Bond Donor | 15 |
Rotatable Bonds | 27 |
99886-31-4 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9643 | 96.43% |
Caco-2 | - | 0.8699 | 86.99% |
Blood Brain Barrier | - | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.6429 | 64.29% |
Subcellular localzation | Mitochondria | 0.4910 | 49.10% |
OATP2B1 inhibitior | - | 0.8556 | 85.56% |
OATP1B1 inhibitior | + | 0.8917 | 89.17% |
OATP1B3 inhibitior | + | 0.9394 | 93.94% |
MATE1 inhibitior | - | 0.7299 | 72.99% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 0.9621 | 96.21% |
P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
P-glycoprotein substrate | + | 0.8535 | 85.35% |
CYP3A4 substrate | + | 0.7139 | 71.39% |
CYP2C9 substrate | - | 0.7983 | 79.83% |
CYP2D6 substrate | - | 0.8113 | 81.13% |
CYP3A4 inhibition | - | 0.8334 | 83.34% |
CYP2C9 inhibition | - | 0.8712 | 87.12% |
CYP2C19 inhibition | - | 0.8524 | 85.24% |
CYP2D6 inhibition | - | 0.8876 | 88.76% |
CYP1A2 inhibition | - | 0.9228 | 92.28% |
CYP2C8 inhibition | + | 0.5429 | 54.29% |
CYP inhibitory promiscuity | - | 0.8928 | 89.28% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.8700 | 87.00% |
Carcinogenicity (trinary) | Non-required | 0.6206 | 62.06% |
Eye corrosion | - | 0.9895 | 98.95% |
Eye irritation | - | 0.8992 | 89.92% |
Skin irritation | - | 0.7987 | 79.87% |
Skin corrosion | - | 0.9371 | 93.71% |
Ames mutagenesis | - | 0.8600 | 86.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6790 | 67.90% |
Micronuclear | + | 0.6900 | 69.00% |
Hepatotoxicity | - | 0.5364 | 53.64% |
skin sensitisation | - | 0.8911 | 89.11% |
Respiratory toxicity | + | 0.8444 | 84.44% |
Reproductive toxicity | + | 0.9333 | 93.33% |
Mitochondrial toxicity | + | 0.8750 | 87.50% |
Nephrotoxicity | - | 0.9086 | 90.86% |
Acute Oral Toxicity (c) | III | 0.6210 | 62.10% |
Estrogen receptor binding | + | 0.7436 | 74.36% |
Androgen receptor binding | + | 0.5691 | 56.91% |
Thyroid receptor binding | + | 0.6199 | 61.99% |
Glucocorticoid receptor binding | + | 0.6110 | 61.10% |
Aromatase binding | + | 0.6381 | 63.81% |
PPAR gamma | + | 0.7440 | 74.40% |
Honey bee toxicity | - | 0.8196 | 81.96% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.7200 | 72.00% |
Fish aquatic toxicity | - | 0.7437 | 74.37% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.81% | 83.82% |
CHEMBL3837 | P07711 | Cathepsin L | 99.56% | 96.61% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.99% | 97.64% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.90% | 88.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.27% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.17% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.45% | 97.09% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.85% | 90.08% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 95.21% | 83.10% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.77% | 98.33% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 94.29% | 90.20% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 93.89% | 88.42% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.84% | 91.81% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 93.61% | 95.38% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 92.71% | 97.23% |
CHEMBL3176 | O43603 | Galanin receptor 2 | 92.34% | 98.89% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.92% | 96.47% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.88% | 97.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.97% | 94.45% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.98% | 95.56% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 89.13% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.12% | 90.00% |
CHEMBL4123 | P30989 | Neurotensin receptor 1 | 87.46% | 96.67% |
CHEMBL5028 | O14672 | ADAM10 | 86.90% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.67% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.58% | 99.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.33% | 91.71% |
CHEMBL2535 | P11166 | Glucose transporter | 86.13% | 98.75% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.19% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.98% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.78% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.35% | 95.83% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.07% | 95.00% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.68% | 96.67% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.40% | 93.03% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.15% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.14% | 93.99% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.33% | 91.19% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.43% | 93.56% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 80.26% | 98.59% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.15% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rhinacanthus nasutus |
PubChem | 78169841 |
LOTUS | LTS0068380 |
wikiData | Q27134846 |