methyl (1R,4aR,10aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate
Internal ID | 0ec011b2-0ff0-44ff-8edb-e4329ef3400f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl (1R,4aR,10aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
SMILES (Canonical) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2=O)(C)C(=O)OC)C |
SMILES (Isomeric) | CC(C)C1=CC2=C(C=C1)[C@@]3(CCC[C@@]([C@H]3CC2=O)(C)C(=O)OC)C |
InChI | InChI=1S/C21H28O3/c1-13(2)14-7-8-16-15(11-14)17(22)12-18-20(16,3)9-6-10-21(18,4)19(23)24-5/h7-8,11,13,18H,6,9-10,12H2,1-5H3/t18-,20-,21+/m0/s1 |
InChI Key | URPBIQPJABGDJD-SESVDKBCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O3 |
Molecular Weight | 328.40 g/mol |
Exact Mass | 328.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 4.80 |
There are no found synonyms. |
![2D Structure of methyl (1R,4aR,10aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate 2D Structure of methyl (1R,4aR,10aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/bce10900-8585-11ee-88d1-29a9771278f3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.88% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.19% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.78% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.56% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.42% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.91% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.70% | 91.07% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.69% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.50% | 91.19% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.90% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 87.61% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.40% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.31% | 83.82% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.92% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.60% | 99.15% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.09% | 96.77% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.56% | 93.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.10% | 86.33% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.98% | 95.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.16% | 92.62% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.79% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.48% | 97.50% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.00% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mikania triangularis |
PubChem | 92332054 |
LOTUS | LTS0105014 |
wikiData | Q105277927 |