[(1S,19R,21S,22R,23R)-7,8,11,12,13,22,23-heptahydroxy-3,16-dioxo-6-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-21-yl] 3,4,5-trihydroxybenzoate
Internal ID | 5c9552da-1987-4405-a8d7-7394a1210496 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1S,19R,21S,22R,23R)-7,8,11,12,13,22,23-heptahydroxy-3,16-dioxo-6-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-21-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)O)O)O)O |
InChI | InChI=1S/C34H26O22/c35-12-1-8(2-13(36)21(12)40)30(48)53-17-6-11-20(27(46)24(17)43)19-10(5-16(39)23(42)26(19)45)32(50)52-7-18-25(44)29(55-33(11)51)28(47)34(54-18)56-31(49)9-3-14(37)22(41)15(38)4-9/h1-6,18,25,28-29,34-47H,7H2/t18-,25-,28-,29+,34+/m1/s1 |
InChI Key | REMWHQXBHCEELJ-RBQLCBAQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H26O22 |
Molecular Weight | 786.60 g/mol |
Exact Mass | 786.09157245 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.97% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.59% | 94.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.51% | 83.00% |
CHEMBL3194 | P02766 | Transthyretin | 89.29% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.73% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.42% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.03% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.96% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 85.07% | 98.75% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.48% | 96.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.23% | 95.78% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.12% | 91.49% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.79% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.53% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cunonia macrophylla |
PubChem | 102207107 |
LOTUS | LTS0076379 |
wikiData | Q105234961 |