4,7-Dimethyl-18-(2-methylsulfinylethyl)-6-oxa-13,20-dithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione
| Internal ID | 6a1fcc8d-eec8-4c0c-803c-aed55457ca7d |
| Taxonomy | Organoheterocyclic compounds > Azoles > Thiazoles |
| IUPAC Name | 4,7-dimethyl-18-(2-methylsulfinylethyl)-6-oxa-13,20-dithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione |
| SMILES (Canonical) | CC1C2=NC(=C(O2)C)C(=O)NCC3=NC(=CS3)C(=O)NC(C4=NC(=CS4)C(=O)N1)CCS(=O)C |
| SMILES (Isomeric) | CC1C2=NC(=C(O2)C)C(=O)NCC3=NC(=CS3)C(=O)NC(C4=NC(=CS4)C(=O)N1)CCS(=O)C |
| InChI | InChI=1S/C20H22N6O5S3/c1-9-19-26-15(10(2)31-19)18(29)21-6-14-23-12(7-32-14)17(28)24-11(4-5-34(3)30)20-25-13(8-33-20)16(27)22-9/h7-9,11H,4-6H2,1-3H3,(H,21,29)(H,22,27)(H,24,28) |
| InChI Key | ILKYNUWKOMIMLZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22N6O5S3 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.08138134 g/mol |
| Topological Polar Surface Area (TPSA) | 232.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 94.01% | 97.53% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.52% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.75% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.52% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.99% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.58% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.23% | 93.99% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.12% | 93.03% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.51% | 94.73% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 86.11% | 88.84% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.06% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.66% | 94.75% |
| CHEMBL2147 | P11309 | Serine/threonine-protein kinase PIM1 | 85.27% | 97.95% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 85.23% | 96.39% |
| CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 85.04% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.88% | 85.14% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.01% | 98.59% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.40% | 93.10% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.36% | 89.34% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.60% | 96.67% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.57% | 91.24% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.12% | 90.08% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.11% | 80.71% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.84% | 86.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.67% | 97.09% |
| CHEMBL2828 | P48730 | Casein kinase I delta | 80.64% | 93.08% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.39% | 88.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73309016 |
| LOTUS | LTS0114788 |
| wikiData | Q104168899 |