[(1S,3S,5S,7S,9S,10S,12R,14S,15S,18S,19S,20S,22S,23S)-14-formyl-9,10,22-trihydroxy-7,18-dimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosan-20-yl] acetate
Internal ID | e0815be0-ebfc-46ca-927a-fb9d44b1678a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | [(1S,3S,5S,7S,9S,10S,12R,14S,15S,18S,19S,20S,22S,23S)-14-formyl-9,10,22-trihydroxy-7,18-dimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosan-20-yl] acetate |
SMILES (Canonical) | CC1CC(C2(C(O1)OC3CC4CCC5C(C4(CC3O2)C=O)CCC6(C5(CC(C6C7=CC(=O)OC7)OC(=O)C)O)C)O)O |
SMILES (Isomeric) | C[C@H]1C[C@@H]([C@]2([C@@H](O1)O[C@H]3C[C@@H]4CC[C@H]5[C@@H]([C@@]4(C[C@H]3O2)C=O)CC[C@@]6([C@@]5(C[C@@H]([C@H]6C7=CC(=O)OC7)OC(=O)C)O)C)O)O |
InChI | InChI=1S/C31H42O11/c1-15-8-24(34)31(37)27(39-15)41-21-10-18-4-5-20-19(29(18,14-32)11-22(21)42-31)6-7-28(3)26(17-9-25(35)38-13-17)23(40-16(2)33)12-30(20,28)36/h9,14-15,18-24,26-27,34,36-37H,4-8,10-13H2,1-3H3/t15-,18-,19-,20-,21-,22+,23-,24-,26+,27-,28-,29-,30-,31-/m0/s1 |
InChI Key | BMPDNBQADRWROC-GUPBXJTHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H42O11 |
Molecular Weight | 590.70 g/mol |
Exact Mass | 590.27271215 g/mol |
Topological Polar Surface Area (TPSA) | 158.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.31% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.28% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.16% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.86% | 94.45% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.57% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.38% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.15% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.50% | 91.11% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.36% | 81.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.29% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.94% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.20% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.80% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.67% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.16% | 91.19% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.23% | 93.04% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.90% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.54% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 82.50% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.96% | 93.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.58% | 97.36% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.38% | 82.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.46% | 97.14% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.39% | 97.28% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.22% | 94.62% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.12% | 94.42% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.02% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asclepias curassavica |
PubChem | 157396181 |
LOTUS | LTS0127068 |
wikiData | Q104938481 |