(1R,4R,5R,11R,15R,16R,22R)-4,15-bis(3,5-dihydroxyphenyl)-16-[(2R,3S)-3-[(2S,3S)-3-(3,5-dihydroxyphenyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-5,11,22-tris(4-hydroxyphenyl)-6,17-dioxahexacyclo[10.9.1.02,10.03,7.013,21.014,18]docosa-2(10),3(7),8,13(21),14(18),19-hexaene-9,20-diol
| Internal ID | 586a34ee-7136-4666-b263-ee77adabc5cd |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | (1R,4R,5R,11R,15R,16R,22R)-4,15-bis(3,5-dihydroxyphenyl)-16-[(2R,3S)-3-[(2S,3S)-3-(3,5-dihydroxyphenyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-5,11,22-tris(4-hydroxyphenyl)-6,17-dioxahexacyclo[10.9.1.02,10.03,7.013,21.014,18]docosa-2(10),3(7),8,13(21),14(18),19-hexaene-9,20-diol |
| SMILES (Canonical) | C1=CC(=CC=C1C2C3C(C4=C(C2C5=C3C6=C(C=C5O)OC(C6C7=CC(=CC(=C7)O)O)C8=CC9=C(C=C8)OC(C9C1=C2C(C(OC2=CC(=C1)O)C1=CC=C(C=C1)O)C1=CC(=CC(=C1)O)O)C1=CC=C(C=C1)O)C1=C(C=C4O)OC(C1C1=CC(=CC(=C1)O)O)C1=CC=C(C=C1)O)C1=CC=C(C=C1)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1[C@H]2[C@H]3C4=C(C2[C@@H](C5=C3C6=C(C=C5O)O[C@H]([C@@H]6C7=CC(=CC(=C7)O)O)C8=CC=C(C=C8)O)C9=CC=C(C=C9)O)C1=C(C=C4O)O[C@H]([C@@H]1C1=CC(=CC(=C1)O)O)C1=CC2=C(C=C1)O[C@H]([C@H]2C1=C2[C@@H]([C@H](OC2=CC(=C1)O)C1=CC=C(C=C1)O)C1=CC(=CC(=C1)O)O)C1=CC=C(C=C1)O)O |
| InChI | InChI=1S/C84H62O18/c85-46-12-1-37(2-13-46)66-73-60(97)35-64-75(69(44-25-53(92)31-54(93)26-44)82(101-64)40-7-18-49(88)19-8-40)79(73)78-67(38-3-14-47(86)15-4-38)77(66)80-74(78)61(98)36-65-76(80)70(45-27-55(94)32-56(95)28-45)84(102-65)42-11-22-62-58(29-42)71(83(99-62)41-9-20-50(89)21-10-41)59-33-57(96)34-63-72(59)68(43-23-51(90)30-52(91)24-43)81(100-63)39-5-16-48(87)17-6-39/h1-36,66-71,77-78,81-98H/t66-,67-,68+,69-,70-,71-,77?,78+,81-,82+,83+,84+/m1/s1 |
| InChI Key | UWVJBUUPORTNLH-JBVPZGINSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C84H62O18 |
| Molecular Weight | 1359.40 g/mol |
| Exact Mass | 1358.39361512 g/mol |
| Topological Polar Surface Area (TPSA) | 320.00 Ų |
| XlogP | 13.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.87% | 93.40% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.34% | 99.15% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.76% | 93.10% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.07% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.59% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.50% | 95.56% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.60% | 90.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.96% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.51% | 94.73% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 84.30% | 89.44% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.56% | 97.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.13% | 94.45% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.58% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Upuna borneensis |
| PubChem | 163192028 |
| LOTUS | LTS0033182 |
| wikiData | Q105280572 |