(2R,3R,4S,5R,6S)-2-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(3,4,5-trimethoxyphenoxy)oxane-3,4,5-triol
| Internal ID | bef6f1ae-bbbb-4391-b458-ad7c81cb90ae |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(3,4,5-trimethoxyphenoxy)oxane-3,4,5-triol |
| SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)OC2C(C(C(C(O2)COC3C(C(C(O3)CO)O)O)O)O)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO[C@@H]3[C@H]([C@H]([C@H](O3)CO)O)O)O)O)O |
| InChI | InChI=1S/C20H30O13/c1-27-9-4-8(5-10(28-2)18(9)29-3)31-20-17(26)15(24)14(23)12(33-20)7-30-19-16(25)13(22)11(6-21)32-19/h4-5,11-17,19-26H,6-7H2,1-3H3/t11-,12-,13+,14+,15+,16+,17-,19+,20-/m1/s1 |
| InChI Key | DNJIJZMHHOJKML-XHYCBVGGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O13 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.16864101 g/mol |
| Topological Polar Surface Area (TPSA) | 186.00 Ų |
| XlogP | -1.90 |
| There are no found synonyms. |
![2D Structure of (2R,3R,4S,5R,6S)-2-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(3,4,5-trimethoxyphenoxy)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/bbc7d9e0-85ee-11ee-88eb-1943eaf7f6bc.jpg "2D Structure of (2R,3R,4S,5R,6S)-2-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(3,4,5-trimethoxyphenoxy)oxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.40% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.75% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.16% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.92% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.98% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.93% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.51% | 94.73% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.41% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.80% | 90.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.28% | 95.89% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.98% | 86.92% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.95% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162929377 |
| LOTUS | LTS0196978 |
| wikiData | Q104985585 |