[(10R,11S,13R,14R,15S)-11-[3-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,14,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32(37),33,35-dodecaen-36-yl]oxy]-4,5-dihydroxybenzoyl]oxy-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate
Internal ID | e02deecb-2c0a-469c-b49b-a8de3f5a1a15 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10R,11S,13R,14R,15S)-11-[3-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,14,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32(37),33,35-dodecaen-36-yl]oxy]-4,5-dihydroxybenzoyl]oxy-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=C(C8=C(C(=C(C=C8C(=O)O1)O)O)O)C(=C(C(=C7OC9=CC(=CC(=C9O)O)C(=O)OC1C2C(C(C(O1)COC(=O)C1=CC(=C(C(=C1)O)O)O)O)OC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C=C1C(=O)O2)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@H]3[C@H]([C@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=C(C8=C(C(=C(C=C8C(=O)O1)O)O)O)C(=C(C(=C7OC9=CC(=CC(=C9O)O)C(=O)O[C@H]1[C@H]2[C@H]([C@@H]([C@H](O1)COC(=O)C1=CC(=C(C(=C1)O)O)O)O)OC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C=C1C(=O)O2)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C75H52O48/c76-22-1-14(2-23(77)42(22)86)65(103)112-12-33-50(94)61-63(120-71(109)20-10-30(84)47(91)53(97)37(20)35-18(69(107)118-61)8-28(82)45(89)51(35)95)74(115-33)123-67(105)16-5-26(80)44(88)32(6-16)114-60-41-40(56(100)57(101)58(60)102)39-17(7-27(81)49(93)55(39)99)68(106)113-13-34-59(117-73(41)111)62-64(75(116-34)122-66(104)15-3-24(78)43(87)25(79)4-15)121-72(110)21-11-31(85)48(92)54(98)38(21)36-19(70(108)119-62)9-29(83)46(90)52(36)96/h1-11,33-34,50,59,61-64,74-102H,12-13H2/t33-,34-,50-,59-,61+,62+,63-,64-,74+,75-/m1/s1 |
InChI Key | BGCNHJGZQJKBNH-ONLYDNLESA-N |
Popularity | 0 references in papers |
Molecular Formula | C75H52O48 |
Molecular Weight | 1721.20 g/mol |
Exact Mass | 1720.1628034 g/mol |
Topological Polar Surface Area (TPSA) | 811.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of [(10R,11S,13R,14R,15S)-11-[3-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,14,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32(37),33,35-dodecaen-36-yl]oxy]-4,5-dihydroxybenzoyl]oxy-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate 2D Structure of [(10R,11S,13R,14R,15S)-11-[3-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,14,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32(37),33,35-dodecaen-36-yl]oxy]-4,5-dihydroxybenzoyl]oxy-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/bba39df0-8538-11ee-ba4b-330f1b6b3c80.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 99.10% | 95.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.73% | 91.49% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.53% | 97.21% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.43% | 83.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.98% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.47% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.07% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.75% | 99.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 89.34% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 89.34% | 90.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.24% | 96.95% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 87.91% | 80.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.07% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.79% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 86.49% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.42% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.98% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.62% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 85.16% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.97% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.66% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.05% | 96.61% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.68% | 92.62% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.59% | 92.50% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.05% | 95.64% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.51% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.36% | 100.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.19% | 95.78% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.18% | 83.57% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.47% | 89.34% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.23% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rosa henryi |
PubChem | 16157736 |
LOTUS | LTS0219210 |
wikiData | Q104935391 |