methyl (5E,6S)-4-[2-[2-[3-acetyloxy-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]ethoxy]-2-oxoethyl]-5-ethylidene-6-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | 9944cad6-be60-4fe9-9b55-4eb567fdc27b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | methyl (5E,6S)-4-[2-[2-[3-acetyloxy-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]ethoxy]-2-oxoethyl]-5-ethylidene-6-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)C(=O)OC)CC(=O)OCCC3=CC(=C(C=C3)OC4C(C(C(C(O4)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | C/C=C\1/[C@@H](OC=C(C1CC(=O)OCCC2=CC(=C(C=C2)OC3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)C(=O)OC)OC4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C49H60O27/c1-12-32-33(34(46(60)61-11)19-65-47(32)76-49-45(72-30(10)58)43(70-28(8)56)41(68-26(6)54)38(75-49)21-64-23(3)51)18-39(59)62-16-15-31-13-14-35(36(17-31)66-24(4)52)73-48-44(71-29(9)57)42(69-27(7)55)40(67-25(5)53)37(74-48)20-63-22(2)50/h12-14,17,19,33,37-38,40-45,47-49H,15-16,18,20-21H2,1-11H3/b32-12+/t33?,37-,38-,40-,41-,42+,43+,44-,45-,47+,48?,49?/m1/s1 |
InChI Key | WILIFRSPMCBMKB-RURJUHLQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C49H60O27 |
Molecular Weight | 1081.00 g/mol |
Exact Mass | 1080.33219663 g/mol |
Topological Polar Surface Area (TPSA) | 335.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of methyl (5E,6S)-4-[2-[2-[3-acetyloxy-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]ethoxy]-2-oxoethyl]-5-ethylidene-6-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate 2D Structure of methyl (5E,6S)-4-[2-[2-[3-acetyloxy-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]ethoxy]-2-oxoethyl]-5-ethylidene-6-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/bb73f590-85f2-11ee-bc92-572e542e63a3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.99% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.07% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.47% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 95.25% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 93.65% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.01% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.73% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.86% | 91.49% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.18% | 95.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.18% | 91.11% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.77% | 96.90% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.64% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.14% | 94.00% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 84.75% | 87.16% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.02% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.41% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.11% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.76% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.27% | 94.80% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.23% | 94.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.19% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea clypeolata |
Achillea crithmifolia |
Artemisia gmelinii |
Artemisia tripartita |
Artemisia xerophytica |
Fraxinus angustifolia |
Schistostephium rotundifolium |
Tanacetum santolina |
PubChem | 163010818 |
LOTUS | LTS0265706 |
wikiData | Q104914225 |