Bazzanene
| Internal ID | 323c77e7-9971-4d7a-83b6-8df1fe74b734 |
| Taxonomy | Hydrocarbons > Unsaturated hydrocarbons > Branched unsaturated hydrocarbons |
| IUPAC Name | (4R)-1,4-dimethyl-4-[(1S)-1-methyl-2-methylidenecyclopentyl]cyclohexene |
| SMILES (Canonical) | CC1=CCC(CC1)(C)C2(CCCC2=C)C |
| SMILES (Isomeric) | CC1=CC[C@](CC1)(C)[C@]2(CCCC2=C)C |
| InChI | InChI=1S/C15H24/c1-12-7-10-14(3,11-8-12)15(4)9-5-6-13(15)2/h7H,2,5-6,8-11H2,1,3-4H3/t14-,15-/m0/s1 |
| InChI Key | YFLSTROSSKYYNK-GJZGRUSLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.70 |
| .beta.-Bazzanene |
| 24493-43-4 |
| J4TV61KI1L |
| UNII-J4TV61KI1L |
| BAZZANENE, (+)- |
| DTXSID80947388 |
| YFLSTROSSKYYNK-GJZGRUSLSA-N |
| Q27281206 |
| 1,4-Dimethyl-4-(1-methyl-2-methylidenecyclopentyl)cyclohex-1-ene |
| CYCLOHEXENE, 1,4-DIMETHYL-4-((1S)-1-METHYL-2-METHYLENECYCLOPENTYL)-, (4R)- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.50% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.72% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.53% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.34% | 95.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.40% | 97.79% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.23% | 90.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.22% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.91% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.20% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.21% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bazzania fauriana |
| Bazzania trilobata |
| Frullania tamarisci |
| Reboulia hemisphaerica |
| Zea mays |
| PubChem | 179421 |
| LOTUS | LTS0080333 |
| wikiData | Q27281206 |