Bagremycin B
| Internal ID | 2e0bc627-7765-4b43-9eab-e95a3120434c |
| Taxonomy | Phenylpropanoids and polyketides > Depsides and depsidones |
| IUPAC Name | (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H15NO4/c1-3-12-4-7-14(8-5-12)22-17(21)13-6-9-16(20)15(10-13)18-11(2)19/h3-10,20H,1H2,2H3,(H,18,19) |
| InChI Key | GIZFCCIAJXWSKK-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 75.60 Ų |
| XlogP | 2.90 |
| CHEMBL4129272 |
| (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.86% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.95% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.93% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.71% | 94.73% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 92.46% | 91.07% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.18% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.90% | 91.19% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.64% | 89.34% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.35% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.13% | 86.33% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 87.41% | 87.67% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.25% | 97.21% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.99% | 81.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.29% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.89% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.56% | 96.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.37% | 97.53% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.28% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10447329 |
| LOTUS | LTS0126723 |
| wikiData | Q77278526 |