(2R,3R,4S,5S,6R)-2-[[(2S,3S,4S)-2-(1,3-benzodioxol-5-yl)-4-[(S)-1,3-benzodioxol-5-yl(hydroxy)methyl]oxolan-3-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | ae43863a-eae4-457e-a689-89759d8a9dd7 |
| Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2S,3S,4S)-2-(1,3-benzodioxol-5-yl)-4-[(S)-1,3-benzodioxol-5-yl(hydroxy)methyl]oxolan-3-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | C1C(C(C(O1)C2=CC3=C(C=C2)OCO3)COC4C(C(C(C(O4)CO)O)O)O)C(C5=CC6=C(C=C5)OCO6)O |
| SMILES (Isomeric) | C1[C@H]([C@H]([C@H](O1)C2=CC3=C(C=C2)OCO3)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)[C@@H](C5=CC6=C(C=C5)OCO6)O |
| InChI | InChI=1S/C26H30O12/c27-7-20-22(29)23(30)24(31)26(38-20)33-9-15-14(21(28)12-1-3-16-18(5-12)36-10-34-16)8-32-25(15)13-2-4-17-19(6-13)37-11-35-17/h1-6,14-15,20-31H,7-11H2/t14-,15-,20-,21-,22-,23+,24-,25-,26-/m1/s1 |
| InChI Key | NDHRYHNUYZKJJJ-WVUUXUIYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H30O12 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.17372639 g/mol |
| Topological Polar Surface Area (TPSA) | 166.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.72% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.14% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.80% | 85.14% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 92.96% | 94.80% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.53% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.55% | 96.77% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.78% | 95.93% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.73% | 94.73% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.17% | 92.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.96% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.50% | 89.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.27% | 96.61% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.99% | 95.89% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.43% | 100.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.80% | 97.36% |
| CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 80.97% | 87.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lancea tibetica |
| PubChem | 101040466 |
| LOTUS | LTS0182375 |
| wikiData | Q105177552 |