Bacitracin A (8CI)
| Internal ID | 2e966eee-c533-4f39-a18e-684f37b63d6b |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (4R)-4-[[(2S)-2-[[2-[(1S)-1-amino-2-methylbutyl]-4,5-dihydro-1,3-thiazole-5-carbonyl]amino]-4-methylpentanoyl]amino]-5-[[(2S)-1-[[(3S,6R,9S,12R,15S,18R,21S)-3-(2-amino-2-oxoethyl)-18-(3-aminopropyl)-12-benzyl-15-butan-2-yl-6-(carboxymethyl)-9-(1H-imidazol-5-ylmethyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclopentacos-21-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCCCCC(C(=O)NC(C(=O)N1)CCCN)NC(=O)C(C(C)CC)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C2CN=C(S2)C(C(C)CC)N)CC(=O)N)CC(=O)O)CC3=CN=CN3)CC4=CC=CC=C4 |
| SMILES (Isomeric) | CCC(C)[C@H]1C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)NCCCC[C@@H](C(=O)N[C@@H](C(=O)N1)CCCN)NC(=O)[C@H](C(C)CC)NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)C2CN=C(S2)[C@H](C(C)CC)N)CC(=O)N)CC(=O)O)CC3=CN=CN3)CC4=CC=CC=C4 |
| InChI | InChI=1S/C66H103N17O16S/c1-9-35(6)52(69)66-72-32-48(100-66)63(97)80-43(26-34(4)5)59(93)75-42(22-23-50(85)86)58(92)83-53(36(7)10-2)64(98)76-40-20-15-16-25-71-55(89)46(29-49(68)84)78-62(96)47(30-51(87)88)79-61(95)45(28-39-31-70-33-73-39)77-60(94)44(27-38-18-13-12-14-19-38)81-65(99)54(37(8)11-3)82-57(91)41(21-17-24-67)74-56(40)90/h12-14,18-19,31,33-37,40-48,52-54H,9-11,15-17,20-30,32,67,69H2,1-8H3,(H2,68,84)(H,70,73)(H,71,89)(H,74,90)(H,75,93)(H,76,98)(H,77,94)(H,78,96)(H,79,95)(H,80,97)(H,81,99)(H,82,91)(H,83,92)(H,85,86)(H,87,88)/t35?,36?,37?,40-,41+,42+,43-,44+,45-,46-,47+,48?,52-,53-,54-/m0/s1 |
| InChI Key | MNJKVJAYSVAQLU-YOJCIBLDSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C66H103N17O16S |
| Molecular Weight | 1422.70 g/mol |
| Exact Mass | 1421.74894144 g/mol |
| Topological Polar Surface Area (TPSA) | 556.00 Ų |
| XlogP | -4.30 |
| Atomic LogP (AlogP) | -1.68 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 31 |
| Bacitracin A1 (9CI) |
| SCHEMBL1059374 |
| CHEMBL1237057 |
| 1,4,7,10,13,16,19-Heptaazacyclopentacosane, cyclic peptide deriv. |
| 1-[N-[[2-(1-Amino-2-methylbutyl)-4,5-dihydro-4-thiazolyl]carbonyl]-L-leucine]-Bacitracin F |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5473 | 54.73% |
| Caco-2 | - | 0.8662 | 86.62% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | + | 0.5143 | 51.43% |
| Subcellular localzation | Mitochondria | 0.4232 | 42.32% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9028 | 90.28% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | - | 0.9209 | 92.09% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.9661 | 96.61% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8731 | 87.31% |
| CYP3A4 substrate | + | 0.7479 | 74.79% |
| CYP2C9 substrate | - | 0.8067 | 80.67% |
| CYP2D6 substrate | - | 0.8493 | 84.93% |
| CYP3A4 inhibition | - | 0.9011 | 90.11% |
| CYP2C9 inhibition | - | 0.9071 | 90.71% |
| CYP2C19 inhibition | - | 0.9025 | 90.25% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.9046 | 90.46% |
| CYP2C8 inhibition | + | 0.8303 | 83.03% |
| CYP inhibitory promiscuity | - | 0.9122 | 91.22% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6027 | 60.27% |
| Eye corrosion | - | 0.9851 | 98.51% |
| Eye irritation | - | 0.8957 | 89.57% |
| Skin irritation | - | 0.7691 | 76.91% |
| Skin corrosion | - | 0.9241 | 92.41% |
| Ames mutagenesis | - | 0.6600 | 66.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7048 | 70.48% |
| Micronuclear | + | 0.7200 | 72.00% |
| Hepatotoxicity | + | 0.6477 | 64.77% |
| skin sensitisation | - | 0.8334 | 83.34% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9484 | 94.84% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | + | 0.7235 | 72.35% |
| Acute Oral Toxicity (c) | III | 0.5690 | 56.90% |
| Estrogen receptor binding | + | 0.5286 | 52.86% |
| Androgen receptor binding | + | 0.7188 | 71.88% |
| Thyroid receptor binding | + | 0.7281 | 72.81% |
| Glucocorticoid receptor binding | + | 0.7938 | 79.38% |
| Aromatase binding | + | 0.8064 | 80.64% |
| PPAR gamma | + | 0.7153 | 71.53% |
| Honey bee toxicity | - | 0.6647 | 66.47% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
| Fish aquatic toxicity | + | 0.9177 | 91.77% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.93% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.65% | 96.09% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 99.63% | 88.42% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.20% | 97.64% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.81% | 90.17% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.38% | 97.23% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.83% | 98.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.50% | 97.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.30% | 93.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.26% | 96.61% |
| CHEMBL4071 | P08311 | Cathepsin G | 96.15% | 94.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.08% | 90.08% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.05% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.95% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.65% | 98.05% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 95.00% | 88.10% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.69% | 90.20% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 94.42% | 93.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 93.84% | 96.90% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 93.72% | 97.43% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 93.42% | 90.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.97% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.48% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.94% | 93.10% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 91.88% | 93.85% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 91.76% | 98.24% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.65% | 98.59% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.29% | 95.93% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.99% | 100.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 89.70% | 96.85% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.48% | 95.89% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 89.23% | 82.86% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.22% | 95.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.10% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.75% | 95.50% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 88.03% | 98.94% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.94% | 92.88% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.67% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.56% | 88.56% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 86.40% | 96.67% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 85.50% | 89.92% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.25% | 98.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.97% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.94% | 97.14% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.27% | 96.11% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.01% | 96.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.29% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.17% | 94.45% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.07% | 97.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.66% | 97.50% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 81.12% | 95.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 439542 |
| LOTUS | LTS0066152 |
| wikiData | Q105168407 |