(2S)-N-[(2S)-1-[(3S,7R,10S,13Z)-10-benzyl-16-methoxy-8,11-dioxo-2-oxa-6,9,12-triazatricyclo[13.3.1.03,7]nonadeca-1(19),13,15,17-tetraen-6-yl]-1-oxo-3-phenylpropan-2-yl]-2-(dimethylamino)-3-phenylpropanamide
Internal ID | 22042e76-fef7-46e6-9bf8-696ea74a6f67 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
IUPAC Name | (2S)-N-[(2S)-1-[(3S,7R,10S,13Z)-10-benzyl-16-methoxy-8,11-dioxo-2-oxa-6,9,12-triazatricyclo[13.3.1.03,7]nonadeca-1(19),13,15,17-tetraen-6-yl]-1-oxo-3-phenylpropan-2-yl]-2-(dimethylamino)-3-phenylpropanamide |
SMILES (Canonical) | CN(C)C(CC1=CC=CC=C1)C(=O)NC(CC2=CC=CC=C2)C(=O)N3CCC4C3C(=O)NC(C(=O)NC=CC5=C(C=CC(=C5)O4)OC)CC6=CC=CC=C6 |
SMILES (Isomeric) | CN(C)[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N3CC[C@H]4[C@@H]3C(=O)N[C@H](C(=O)N/C=C\C5=C(C=CC(=C5)O4)OC)CC6=CC=CC=C6 |
InChI | InChI=1S/C43H47N5O6/c1-47(2)36(27-31-17-11-6-12-18-31)41(50)46-35(26-30-15-9-5-10-16-30)43(52)48-24-22-38-39(48)42(51)45-34(25-29-13-7-4-8-14-29)40(49)44-23-21-32-28-33(54-38)19-20-37(32)53-3/h4-21,23,28,34-36,38-39H,22,24-27H2,1-3H3,(H,44,49)(H,45,51)(H,46,50)/b23-21-/t34-,35-,36-,38-,39+/m0/s1 |
InChI Key | FJSKSYVNULWVAZ-AFXPMGJTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H47N5O6 |
Molecular Weight | 729.90 g/mol |
Exact Mass | 729.35263424 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | 5.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.48% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.04% | 96.09% |
CHEMBL3837 | P07711 | Cathepsin L | 98.94% | 96.61% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.85% | 85.14% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.60% | 97.64% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.11% | 97.14% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 95.91% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.82% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.42% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.23% | 93.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.40% | 95.89% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.40% | 98.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.48% | 91.19% |
CHEMBL204 | P00734 | Thrombin | 88.94% | 96.01% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.15% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.32% | 94.45% |
CHEMBL2327 | P21452 | Neurokinin 2 receptor | 86.85% | 98.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.11% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.78% | 90.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.44% | 91.11% |
CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 84.62% | 87.50% |
CHEMBL2535 | P11166 | Glucose transporter | 82.86% | 98.75% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.66% | 89.50% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.88% | 93.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.06% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ziziphus jujuba |
PubChem | 163195021 |
LOTUS | LTS0054382 |
wikiData | Q104996297 |