7,8-Dihydroxy-5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-2-one
Internal ID | 05739b93-cd20-4f8a-87e4-b680584f7f74 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Coumarin glycosides |
IUPAC Name | 7,8-dihydroxy-5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-2-one |
SMILES (Canonical) | C1=CC(=O)OC2=C(C(=CC(=C21)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=O)OC2=C(C(=CC(=C21)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C21H26O15/c22-4-9-13(26)15(28)17(30)20(34-9)32-5-10-14(27)16(29)18(31)21(35-10)33-8-3-7(23)12(25)19-6(8)1-2-11(24)36-19/h1-3,9-10,13-18,20-23,25-31H,4-5H2 |
InChI Key | JFLCQZNAJDFYPX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H26O15 |
Molecular Weight | 518.40 g/mol |
Exact Mass | 518.12717012 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -3.10 |
There are no found synonyms. |
![2D Structure of 7,8-Dihydroxy-5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-2-one 2D Structure of 7,8-Dihydroxy-5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/baad7470-8534-11ee-93ec-cb2f53c4b209.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.37% | 94.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.23% | 94.45% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.39% | 83.57% |
CHEMBL2581 | P07339 | Cathepsin D | 90.78% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.62% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 90.41% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.90% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.21% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.50% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.45% | 94.73% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.31% | 89.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.77% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.83% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.89% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.46% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.13% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetraphis pellucida |
PubChem | 162883959 |
LOTUS | LTS0002283 |
wikiData | Q105126728 |