[(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxan-3-yl] (E)-3-[4-[(2S,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]prop-2-enoate
Internal ID | 18ee7896-5040-42f1-a5ce-cbb31b52f0c5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-5-O-glycosides |
IUPAC Name | [(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxan-3-yl] (E)-3-[4-[(2S,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O)OC(=O)C=CC7=CC=C(C=C7)OC8C(C(C(C(O8)COC(=O)C=CC9=CC(=C(C=C9)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O)OC(=O)/C=C/C7=CC=C(C=C7)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)COC(=O)C=CC9=CC(=C(C=C9)O)O)O)O)O |
InChI | InChI=1S/C57H62O31/c1-21-52(88-39(65)11-5-22-2-7-26(8-3-22)81-55-48(74)45(71)42(68)36(86-55)19-78-38(64)10-6-23-4-9-28(60)29(61)12-23)47(73)51(77)54(80-21)79-20-37-43(69)46(72)50(76)57(87-37)84-34-17-27-32(82-53(34)24-13-30(62)40(66)31(63)14-24)15-25(59)16-33(27)83-56-49(75)44(70)41(67)35(18-58)85-56/h2-17,21,35-37,41-52,54-58,67-77H,18-20H2,1H3,(H5-,59,60,61,62,63,64,66)/p+1/b11-5+/t21-,35-,36+,37+,41+,42+,43+,44-,45-,46-,47+,48+,49+,50+,51-,52-,54+,55+,56+,57+/m0/s1 |
InChI Key | IWJHPEHMLMMSNP-SPJCCIMQSA-O |
Popularity | 0 references in papers |
Molecular Formula | C57H63O31+ |
Molecular Weight | 1244.10 g/mol |
Exact Mass | 1243.33533021 g/mol |
Topological Polar Surface Area (TPSA) | 492.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.88% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.42% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.39% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.83% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.85% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.01% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.89% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 95.62% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.69% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.24% | 97.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.03% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.64% | 95.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.01% | 83.00% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 90.43% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.77% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.62% | 90.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.64% | 95.93% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 87.33% | 97.31% |
CHEMBL2581 | P07339 | Cathepsin D | 85.81% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.91% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.43% | 94.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.66% | 90.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.79% | 91.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.66% | 92.62% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.19% | 92.32% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.36% | 86.92% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.70% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Petunia reitzii |
PubChem | 163191736 |
LOTUS | LTS0234196 |
wikiData | Q105121679 |