2,3,4,7,8,9,19-Heptahydroxy-14-(1,2,3-trihydroxypropyl)-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaene-12,17-dione
| Internal ID | ddb6bf1b-341e-4fd8-adbe-cbddaf1b6861 |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | 2,3,4,7,8,9,19-heptahydroxy-14-(1,2,3-trihydroxypropyl)-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaene-12,17-dione |
| SMILES (Canonical) | C1=C2C(=C(C(=C1O)O)O)C3=C4C(=C(C(=C3O)O)O)C(C(C(OC2=O)C(C(CO)O)O)OC4=O)O |
| SMILES (Isomeric) | C1=C2C(=C(C(=C1O)O)O)C3=C4C(=C(C(=C3O)O)O)C(C(C(OC2=O)C(C(CO)O)O)OC4=O)O |
| InChI | InChI=1S/C20H18O14/c21-2-5(23)11(25)17-18-15(29)9-8(20(32)34-18)7(13(27)16(30)14(9)28)6-3(19(31)33-17)1-4(22)10(24)12(6)26/h1,5,11,15,17-18,21-30H,2H2 |
| InChI Key | NRJPLYVXFDFZQT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H18O14 |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 482.06965524 g/mol |
| Topological Polar Surface Area (TPSA) | 255.00 Ų |
| XlogP | -2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.23% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.22% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.68% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.05% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.74% | 99.15% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.75% | 96.38% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.48% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.42% | 94.73% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.52% | 83.10% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.47% | 92.88% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.31% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.39% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.36% | 94.00% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.16% | 96.37% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.00% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Osbeckia chinensis |
| PubChem | 14035450 |
| LOTUS | LTS0102543 |
| wikiData | Q105184613 |