N-[(2R,6S)-6-[(3S,5S,8R,9S,10S,13S,14S,16R,17R)-3-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-5-oxoheptyl]butanamide
Internal ID | 321fe236-b08b-435a-866f-a787af78dca2 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | N-[(2R,6S)-6-[(3S,5S,8R,9S,10S,13S,14S,16R,17R)-3-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-5-oxoheptyl]butanamide |
SMILES (Canonical) | CCCC(=O)NCC(C)CCC(=O)C(C)C1C(CC2C1(CCC3C2CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)C)O)O)OC7C(C(C(CO7)O)O)O)O)O)C)C)O |
SMILES (Isomeric) | CCCC(=O)NC[C@H](C)CCC(=O)[C@@H](C)[C@H]1[C@@H](C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)O)C)C)O |
InChI | InChI=1S/C48H81NO17/c1-7-8-34(54)49-19-22(2)9-12-30(51)23(3)35-31(52)18-29-27-11-10-25-17-26(13-15-47(25,5)28(27)14-16-48(29,35)6)63-45-41(60)39(58)42(33(20-50)64-45)65-46-43(38(57)36(55)24(4)62-46)66-44-40(59)37(56)32(53)21-61-44/h22-29,31-33,35-46,50,52-53,55-60H,7-21H2,1-6H3,(H,49,54)/t22-,23-,24+,25+,26+,27-,28+,29+,31-,32-,33-,35+,36+,37+,38-,39-,40-,41-,42-,43-,44+,45-,46+,47+,48+/m1/s1 |
InChI Key | ZHQCXRFCPPZKIJ-IHCVGGSOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H81NO17 |
Molecular Weight | 944.20 g/mol |
Exact Mass | 943.55045012 g/mol |
Topological Polar Surface Area (TPSA) | 284.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.14% | 96.09% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 97.69% | 95.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.56% | 96.61% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 97.15% | 95.58% |
CHEMBL2581 | P07339 | Cathepsin D | 95.56% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.31% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.63% | 96.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.50% | 96.77% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.42% | 97.29% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.17% | 94.45% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.82% | 98.05% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.17% | 95.93% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 91.95% | 97.50% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 91.89% | 89.92% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.25% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 91.13% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.13% | 91.19% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 90.67% | 95.36% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.25% | 96.21% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.43% | 97.25% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.01% | 98.10% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.52% | 92.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 88.49% | 82.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.64% | 99.23% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.50% | 97.93% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 87.08% | 99.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.12% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.48% | 96.43% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.36% | 90.71% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.19% | 92.86% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.90% | 96.33% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.89% | 98.46% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.48% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.18% | 95.83% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.14% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.04% | 94.33% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.03% | 93.10% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.57% | 97.79% |
CHEMBL299 | P17252 | Protein kinase C alpha | 83.56% | 98.03% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.03% | 95.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.87% | 100.00% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 82.82% | 96.28% |
CHEMBL5028 | O14672 | ADAM10 | 82.64% | 97.50% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.37% | 96.90% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.10% | 92.62% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.05% | 96.25% |
CHEMBL204 | P00734 | Thrombin | 81.98% | 96.01% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.81% | 95.89% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.79% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum abutiloides |
PubChem | 163190339 |
LOTUS | LTS0081728 |
wikiData | Q105375933 |