(1S,6R,8R,11R,23R,24R,25S)-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione
Internal ID | 3bdad834-eb7f-412c-b152-5201abab20a8 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (1S,6R,8R,11R,23R,24R,25S)-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione |
SMILES (Canonical) | CN1CCC23C4C5C(CC2=O)C6(C1)C(O6)COC5CC(=O)N4C7=CC(=C(C=C37)OC)OC |
SMILES (Isomeric) | CN1CC[C@]23[C@@H]4[C@H]5[C@@H](CC2=O)[C@@]6(C1)[C@H](O6)CO[C@@H]5CC(=O)N4C7=CC(=C(C=C37)OC)OC |
InChI | InChI=1S/C24H28N2O6/c1-25-5-4-23-12-6-15(29-2)16(30-3)8-14(12)26-20(28)9-17-21(22(23)26)13(7-18(23)27)24(11-25)19(32-24)10-31-17/h6,8,13,17,19,21-22H,4-5,7,9-11H2,1-3H3/t13-,17-,19-,21+,22+,23-,24+/m1/s1 |
InChI Key | RYJBYRAOLAWKPE-DKHCYTQSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H28N2O6 |
Molecular Weight | 440.50 g/mol |
Exact Mass | 440.19473662 g/mol |
Topological Polar Surface Area (TPSA) | 80.80 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of (1S,6R,8R,11R,23R,24R,25S)-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione 2D Structure of (1S,6R,8R,11R,23R,24R,25S)-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione](https://plantaedb.com/storage/docs/compounds/2023/11/b9d41700-8717-11ee-a903-9794c86ba9eb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.02% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.74% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.11% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.82% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.70% | 96.09% |
CHEMBL204 | P00734 | Thrombin | 94.20% | 96.01% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.17% | 93.40% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.82% | 90.71% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.88% | 89.63% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 91.39% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.32% | 96.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.53% | 97.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.61% | 99.23% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 85.80% | 98.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.46% | 92.94% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.00% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 84.62% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.46% | 95.89% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.17% | 92.98% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 83.80% | 98.99% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.56% | 96.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.08% | 92.68% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.84% | 96.39% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.46% | 95.53% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.19% | 94.42% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.98% | 95.34% |
CHEMBL4158 | P49327 | Fatty acid synthase | 80.77% | 82.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.17% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos icaja |
PubChem | 162969776 |
LOTUS | LTS0078215 |
wikiData | Q105247649 |