[15-[1-(4,5-Dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-2-methyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-16-yl]methyl acetate
Internal ID | d912e841-f3bd-4fa7-b3fa-28068981f486 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [15-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-2-methyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-16-yl]methyl acetate |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC5C6(C4(C(=O)C=CC6)C)O5)COC(=O)C)O)C |
SMILES (Isomeric) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC5C6(C4(C(=O)C=CC6)C)O5)COC(=O)C)O)C |
InChI | InChI=1S/C30H40O7/c1-16-13-24(36-26(33)17(16)2)28(5,34)22-9-8-21-19-14-25-30(37-25)11-6-7-23(32)27(30,4)20(19)10-12-29(21,22)15-35-18(3)31/h6-7,19-22,24-25,34H,8-15H2,1-5H3 |
InChI Key | QIBFXWZGBLJTNM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H40O7 |
Molecular Weight | 512.60 g/mol |
Exact Mass | 512.27740361 g/mol |
Topological Polar Surface Area (TPSA) | 102.00 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of [15-[1-(4,5-Dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-2-methyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-16-yl]methyl acetate 2D Structure of [15-[1-(4,5-Dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-2-methyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-16-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/b9cac2a0-8578-11ee-bd34-0fd6cd2a798b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.37% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.11% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.13% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.45% | 91.11% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.93% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.19% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.56% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.53% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.95% | 86.33% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.93% | 97.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.47% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.44% | 99.23% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.56% | 93.04% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.08% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.35% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.32% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.75% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.67% | 89.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.64% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.58% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 82.28% | 97.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.85% | 94.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.63% | 92.62% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.99% | 90.08% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.71% | 91.65% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.69% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis coztomatl |
PubChem | 73123620 |
LOTUS | LTS0028454 |
wikiData | Q105221283 |