2-(2,5-Dimethoxyphenyl)-7,8-dimethoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | 3209019d-280b-4305-a513-a6a8699d949a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 2-(2,5-dimethoxyphenyl)-7,8-dimethoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=CC(=C(C=C1)OC)C2=CC(=O)C3=C(O2)C(=C(C=C3OC4C(C(C(C(O4)CO)O)O)O)OC)OC |
SMILES (Isomeric) | COC1=CC(=C(C=C1)OC)C2=CC(=O)C3=C(O2)C(=C(C=C3OC4C(C(C(C(O4)CO)O)O)O)OC)OC |
InChI | InChI=1S/C25H28O12/c1-31-11-5-6-14(32-2)12(7-11)15-8-13(27)19-16(9-17(33-3)23(34-4)24(19)35-15)36-25-22(30)21(29)20(28)18(10-26)37-25/h5-9,18,20-22,25-26,28-30H,10H2,1-4H3 |
InChI Key | DQPWNQUJEGIJPF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O12 |
Molecular Weight | 520.50 g/mol |
Exact Mass | 520.15807632 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.08% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.57% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.45% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 92.21% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.70% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.63% | 86.92% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.29% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.69% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.38% | 85.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.44% | 96.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.25% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.44% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.42% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.24% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.22% | 92.62% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.19% | 93.31% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.10% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.73% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Andrographis paniculata |
PubChem | 91989998 |
LOTUS | LTS0170096 |
wikiData | Q104987077 |