(2R)-4-[(3S)-9-[(2S,5R)-5-[(1S,4R)-1,4-dihydroxy-4-[(2S,5S)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]-3-hydroxynonyl]-2-methyl-2H-furan-5-one
Internal ID | 83c5c1b2-ed8b-45ca-a182-f8b8d9ecdaf2 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2R)-4-[(3S)-9-[(2S,5R)-5-[(1S,4R)-1,4-dihydroxy-4-[(2S,5S)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]-3-hydroxynonyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCC(C1CCC(O1)C(CCC(C2CCC(O2)CCCCCCC(CCC3=CC(OC3=O)C)O)O)O)O |
SMILES (Isomeric) | CCCCCCCCCC[C@H]([C@@H]1CC[C@H](O1)[C@@H](CC[C@@H]([C@H]2CC[C@@H](O2)CCCCCC[C@@H](CCC3=C[C@H](OC3=O)C)O)O)O)O |
InChI | InChI=1S/C37H66O8/c1-3-4-5-6-7-8-9-14-17-31(39)35-24-25-36(45-35)33(41)22-21-32(40)34-23-20-30(44-34)16-13-11-10-12-15-29(38)19-18-28-26-27(2)43-37(28)42/h26-27,29-36,38-41H,3-25H2,1-2H3/t27-,29+,30+,31-,32+,33-,34-,35+,36+/m1/s1 |
InChI Key | LXQWICXPBCTWOM-BJBRKRPQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H66O8 |
Molecular Weight | 638.90 g/mol |
Exact Mass | 638.47576906 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | 8.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.20% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.44% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.61% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.77% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.69% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.85% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.30% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.01% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.99% | 90.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.86% | 100.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.79% | 89.63% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.58% | 97.79% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.05% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.14% | 93.56% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.79% | 97.29% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.77% | 92.88% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 83.15% | 85.94% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.43% | 99.23% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.15% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona squamosa |
PubChem | 162950131 |
LOTUS | LTS0099257 |
wikiData | Q105159029 |